
CAS Number62089-34-3
Synonyms3-Methoxy-5-methyl-benzoic acid; 3-Methoxy-5-methylbenzoic acid; 5-Methoxy-3-methyl-benzoesaeure; 3-Methoxy-5-methyl-benzoesaeure; 5-methoxy-3-methylbenzoic acid
Molecular FormulaC9H10O3
Molecular Weight166.18
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point311.5±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62089-34-3 |
| Catalog No. | 2A-9045651 |
| Chinese Name | 3-甲氧基-5-甲基苯甲酸 |
| Synonyms | 3-Methoxy-5-methyl-benzoic acid; 3-Methoxy-5-methylbenzoic acid; 5-Methoxy-3-methyl-benzoesaeure; 3-Methoxy-5-methyl-benzoesaeure; 5-methoxy-3-methylbenzoic acid |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 311.5±22.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 445664 |
| SMILES | COc1cc(C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H10O3/c1-6-3-7(9(10)11)5-8(4-6)12-2/h3-5H,1-2H3,(H,10,11) |
| InChI Key | ALUKWQVSCATDLJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Fibroblast Growth Factor | 62031-54-3 | 2A-9045642 |
| 1,2-Propanediamine dihydrochloride | 62063-19-8 | 2A-9045646 |
| 3-[N,N-Bis(methoxycarbonylethyl)]amino-4-methoxyacetanilide | 62072-82-6 | 2A-9045648 |
| trans-4-Aminoadamantan-1-ol hydrochloride | 62075-23-4 | 2A-9045649 |
| Tin(II) trifluoromethanesulfonate | 62086-04-8 | 2A-9045650 |
| 2-Chloro-1,4-benzenediamine hydrochloride | 62106-51-8 | 2A-9045654 |
| Pentaerythityl tetraisostearate | 62125-22-8 | 2A-9045658 |
| Methyl 2-methoxy-5-(ethylsulfonyl)benzoate | 62140-67-4 | 2A-9045662 |
| (4-Methoxyphenyl)(2,2,2-trifluoroethyl)amine | 62158-95-6 | 2A-9045668 |
| 2-Bromophenanthrene | 62162-97-4 | 2A-9045670 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA