
CAS Number61693-42-3
Synonyms2,4-dichloro-1-hydroxy-3-aminobenzene; 1-hydroxy 2,4-dichloro 3-aminobenzene; 2,4-dichloro-3-aminophenol; EINECS 262-909-0; 3-amino-2,4-dichloro-phenol; Phenol,3-amino-2,4-dichloro; 2,4-dichloro-m-aminophenol; 3-Amino-2,4-dichlor-phenol
Molecular FormulaC6H5Cl2NO
Molecular Weight178.01600
Purity98.00%
Density1.56g/cm3
Boiling Point269.2ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61693-42-3 |
| Catalog No. | 2A-9045529 |
| Chinese Name | 3-氨基-2,4-二氯苯酚 |
| Synonyms | 2,4-dichloro-1-hydroxy-3-aminobenzene; 1-hydroxy 2,4-dichloro 3-aminobenzene; 2,4-dichloro-3-aminophenol; EINECS 262-909-0; 3-amino-2,4-dichloro-phenol; Phenol,3-amino-2,4-dichloro; 2,4-dichloro-m-aminophenol; 3-Amino-2,4-dichlor-phenol |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.01600 |
| Purity | 98.00 |
| Density | 1.56g/cm3 |
| Boiling Point | 269.2ºC at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 10041572 |
| SMILES | Nc1c(Cl)ccc(O)c1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c7-3-1-2-4(10)5(8)6(3)9/h1-2,10H,9H2 |
| InChI Key | SYRZWFBWUASJJI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Clopyralid (2-hydroxyethyl)ammonium | 57754-85-5 | 2A-9044891 |
| 2,4-Dibromopyridine | 58530-53-3 | 2A-9045010 |
| 2-(Bromomethyl)-2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolane | 60207-89-8 | 2A-9045308 |
| 2,4-Dimethylphenylhydrazine hydrochloride | 60480-83-3 | 2A-9045341 |
| cis-2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-ylmethyl methanesulfonate | 61397-61-3 | 2A-9045492 |
| 2-Azido-6-benzylaminopurine | 61716-00-5 | 2A-9045538 |
| 2,4-Dichloro-8-methoxyquinazoline | 61948-60-5 | 2A-9045619 |
| 2,4-Dichloro-5-thiazolecarboxylic acid | 62019-56-1 | 2A-9045640 |
| Acifluorfen sodium | 62476-59-9 | 2A-9045713 |
| 2,4-Dichloro-7-methoxyquinazoline | 62484-31-5 | 2A-9045714 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA