
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60966-26-9 |
| Catalog No. | 2A-9045413 |
| Chinese Name | 2'-氨基脱氧鸟苷 |
| Synonyms | 2-amino-9-[(2R,3R,4S,5R)-3-amino-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 285.26 |
| Purity | 98.00 |
| Density | 2.25 g/cm3 |
| Boiling Point | 753.4ºC at 760 mmHg |
| Storage Condition | 2~8°C |
| HTC | 2922199090 |
| PubChem ID | 24893307 |
| SMILES | NC1C(O)C(CO)OC1n2cnc3C(=O)N=C(N)Nc23 |
| InChI | InChI=1S/C10H14N6O4/c11-4-6(18)3(1-17)20-9(4)16-2-13-5-7(16)14-10(12)15-8(5)19/h2-4,6,9,17-18H,1,11H2,(H3,12,14,15,19) |
| InChI Key | InChIKey=ROPTVRLUGSPXNH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Biotechnology & Diagnostics | ||
|---|---|---|
| Boc-3-(2-Naphthyl)-L-alanine | 58438-04-3 | 2A-9044989 |
| 1-Boc-3-pyrrolidinecarbaldehyde | 59379-02-1 | 2A-9045171 |
| Boc-L-Serine | 59524-02-6 | 2A-9045192 |
| Boc-L-aspartic acid 4-methyl ester | 59768-74-0 | 2A-9045239 |
| Boc-L-Proline-methyl ester | 59936-29-7 | 2A-9045273 |
| 3-Amino-N-Boc-L-alanine methyl ester | 61040-20-8 | 2A-9045422 |
| Boc-4-nitro-D-phenylalanine | 61280-75-9 | 2A-9045460 |
| Boc-S-(4-methylbenzyl)-L-cysteine | 61925-77-7 | 2A-9045611 |
| N-Boc-N'-Biotinyl-L-lysine | 62062-43-5 | 2A-9045645 |
| N-Cbz-N'-Boc-D-2,3-diaminopropionic acid | 62234-36-0 | 2A-9045676 |
| Browse all Biotechnology & Diagnostics products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA