
CAS Number60871-83-2
SynonymsMagnesium bis(trifluoromethanesulfonate); magnesium,trifluoromethanesulfonate; Methanesulfonic acid, 1,1,1-trifluoro-, magnesium salt (2:1); MFCD00042601
Molecular Formula(CF3SO3)2Mg
Molecular Weight322.44
Purity97%
Boiling Point162ºC at 760 mmHg
Melting Point≥300 °C (lit.)
AppearanceOff-white to gray powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60871-83-2 |
| Catalog No. | 2A-9045396 |
| Chinese Name | 三氟甲磺酸镁 |
| Synonyms | Magnesium bis(trifluoromethanesulfonate); magnesium,trifluoromethanesulfonate; Methanesulfonic acid, 1,1,1-trifluoro-, magnesium salt (2:1); MFCD00042601 |
| Molecular Formula | (CF3SO3)2Mg |
| Molecular Weight | 322.44 |
| Purity | 97 |
| Boiling Point | 162ºC at 760 mmHg |
| Melting Point | ≥300 °C (lit.) |
| Appearance | Off-white to gray powder |
| Storage Condition | Dispose under dry protective gas, store in a seale |
| Packaging | III |
| HTC | 2904909090 |
| PubChem ID | 24860508 |
| MDL Number | MFCD00042601 |
| SMILES | [Mg++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| InChI | 1S/2CHF3O3S.Mg/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 |
| InChI Key | BZQRBEVTLZHKEA-UHFFFAOYSA-L |
| NACRES Code | NA.22 |
| UNSPSC | 12352302 |
| Hazard Symbols | 8.0 |
| MSDS | msds/45396_1_60871_83_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 1759 Proper shipping name: Corrosive solid, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2,4-Trimethyl-1,3-oxathiolan-5-one | 60822-65-3 | 2A-9045389 |
| 4'-Aminobenzo-15-crown-5-ether | 60835-71-4 | 2A-9045392 |
| 3-Methoxyacrylonitrile | 60838-50-8 | 2A-9045393 |
| Ethyl 2-amino-alpha-(hydroxyimino)thiazol-4-acetate | 60845-81-0 | 2A-9045394 |
| Diazald-N-methyl-13C | 60858-95-9 | 2A-9045395 |
| Nickel(II) trifluoromethanesulfonate | 60871-84-3 | 2A-9045397 |
| 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid | 60875-16-3 | 2A-9045398 |
| 4-Cyano-1-indanone | 60899-34-5 | 2A-9045399 |
| 1-(2,3-Dimethylphenyl)ethyl chloride | 60907-88-2 | 2A-0202173 |
| (Butanedione dioximato)disodium | 60908-54-5 | 2A-9045401 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA