CAS Number60031-08-5
Synonymsindanone-6-carboxylic acid; 3-Oxo-indan-5-carbonsaeure; 2,3-Dihydro-3-oxo-1H-indene-5-carboxylic acid; 6-carboxy-1-indanone; 3-Oxo-indan-5-carboxylic acid; indanone-6-carboxilic acid; MFCD02179295; 3-oxoindane-5-carboxylic acid; 1-Indanone-6-carboxylic acid; 3-Oxo-5-indanecarboxylic acid; Indan-1-one-6-carboxylic acid
Molecular FormulaC10H8O3
Molecular Weight176.17
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point375.2±31.0 °C at 760 mmHg
Melting Point256-260ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60031-08-5 |
| Catalog No. | 2A-9045287 |
| Chinese Name | 1-茚酮-6-甲酸 |
| Synonyms | indanone-6-carboxylic acid; 3-Oxo-indan-5-carbonsaeure; 2,3-Dihydro-3-oxo-1H-indene-5-carboxylic acid; 6-carboxy-1-indanone; 3-Oxo-indan-5-carboxylic acid; indanone-6-carboxilic acid; MFCD02179295; 3-oxoindane-5-carboxylic acid; 1-Indanone-6-carboxylic acid; 3-Oxo-5-indanecarboxylic acid; Indan-1-one-6-carboxylic acid |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 375.2±31.0 °C at 760 mmHg |
| Melting Point | 256-260ºC |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| PubChem ID | 28674399 |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C10H8O3/c11-9-4-3-6-1-2-7(10(12)13)5-8(6)9/h1-2,5H,3-4H2,(H,12,13) |
| InChI Key | BIABIACQHKYEEB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 7-Chloro-8-methyl-2-(trifluoromethyl)quinolin-4-ol | 59108-10-0 | 2A-9045113 |
| 2-Amino-4-bromobenzaldehyde | 59278-65-8 | 2A-0201918 |
| Tetrahydro-3-furancarboxylic acid hydrazide | 59293-32-2 | 2A-9045147 |
| 1-Phenyl-3-[3-(trifluoromethyl)phenyl]acetone | 59756-57-9 | 2A-9045235 |
| 1,5-Dibromo-2,6-naphthalenedicarboxylic acid dimethyl ester | 59950-04-8 | 2A-9045277 |
| 4-(Trifluoromethyl)-1,3-benzothiazol-2-amine | 60388-36-5 | 2A-9045324 |
| Methyl 1-amino-1-cyclopentanecarboxylate hydrochloride | 60421-23-0 | 2A-9045333 |
| 2-Fluoro-6-trifluoromethylbenzaldehyde | 60611-24-7 | 2A-9045357 |
| Ethyl 4-bromomethylcinnamate | 60682-98-6 | 2A-9045369 |
| 2,6-Dichloro-4-hydroxybenzaldehyde | 60964-09-2 | 2A-9045412 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS