![2-[(Acetyloxy)methoxy]ethyl acetate structure, CAS 59278-00-1](/structures/60000/45140_1_59278_00_1.png)
CAS Number59278-00-1
Synonyms(2-Acetoxyethoxy)methyl acetate; Ethanol, 2-[(acetyloxy)methoxy]-, acetate; 2-((Acetyloxy)methoxy)ethyl acetate; 2-Oxa-1,4-Butanediol Diacetate; EINECS 261-686-7
Molecular FormulaC7H12O5
Molecular Weight176.17
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point225.2±20.0 °C at 760 mmHg
AppearanceTransparent colorless or light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59278-00-1 |
| Catalog No. | 2A-9045140 |
| Chinese Name | 2-((乙酰氧基)甲氧基)乙醇乙酸酯 |
| Synonyms | (2-Acetoxyethoxy)methyl acetate; Ethanol, 2-[(acetyloxy)methoxy]-, acetate; 2-((Acetyloxy)methoxy)ethyl acetate; 2-Oxa-1,4-Butanediol Diacetate; EINECS 261-686-7 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 225.2±20.0 °C at 760 mmHg |
| Appearance | Transparent colorless or light yellow liquid |
| Storage Condition | 2-8°C |
| Packaging | Bright Yellow Liquid |
| HTC | 2915390090 |
| PubChem ID | 10231690 |
| MDL Number | MFCD09031327 |
| SMILES | CC(=O)OCCOCOC(C)=O |
| InChI | InChI=1S/C7H12O5/c1-6(8)11-4-3-10-5-12-7(2)9/h3-5H2,1-2H3 |
| InChI Key | XFEQOLXBMLXKDE-UHFFFAOYSA-N |
| MSDS | msds/45140_1_59278_00_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diflucortolone valerate | 59198-70-8 | 2A-9045131 |
| 3-Hydroxy-1-adamantanecarbonitrile | 59223-70-0 | 2A-9045133 |
| Methyl 6-chloro-5-nitronicotinate | 59237-53-5 | 2A-9045135 |
| 2-Bromo-6-nitroaniline | 59255-95-7 | 2A-9045137 |
| Meptazinol hydrochloride | 59263-76-2 | 2A-9045138 |
| 6-Iodo-5-hydroxynicotinic acid | 59288-39-0 | 2A-9045143 |
| 2-Methyl-5-nitronicotinic acid | 59290-81-2 | 2A-9045144 |
| 3-Nitroisonicotinic acid | 59290-82-3 | 2A-9045145 |
| 5-(3-Nitrophenyl)-4H-1,2,4-triazol-3-amine | 59301-20-1 | 2A-9045148 |
| 5-(4-Nitrophenyl)-4H-1,2,4-triazol-3-amine | 59301-21-2 | 2A-9045149 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA