
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58861-48-6 |
| Catalog No. | 2A-9045075 |
| Chinese Name | 2-(4-氟苯基)噻吩 |
| Synonyms | 2-(4-Fluorophenyl)thiophene; T5SJ BR DF; 2-(4-FLUOROPHENYL)-THIOPHENE |
| Molecular Formula | C10H7FS |
| Molecular Weight | 178.23 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 252.3±15.0 °C at 760 mmHg |
| Melting Point | 51.0 to 55.0 °C |
| Storage Condition | 2-8°C |
| HTC | 2934999090 |
| PubChem ID | 37371405 |
| InChI | InChI=1S/C10H7FS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H |
| InChI Key | PURJRGMZIKXDMW-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Amino-6-chloro-3-pyridinecarboxaldehyde | 58584-61-5 | 2A-9045030 |
| 2,6-Dichloro-3-methylpyridine | 58584-94-4 | 2A-9045031 |
| 2,6-Dichloro-3-methyl-5-nitropyridine | 58596-88-6 | 2A-9045035 |
| 5-Nitro-2-benzothiazolethiol | 58759-63-0 | 2A-9045066 |
| 7-Bromoisoquinoline | 58794-09-5 | 2A-9045069 |
| 2-(4-Fluorophenyl)pyridine | 58861-53-3 | 2A-9045076 |
| 2-Propyl-1H-imidazole-4,5-dicarboxy acid | 58954-23-7 | 2A-9045087 |
| Methyl 5-benzoylfuran-2-carboxylate | 58972-21-7 | 2A-9045093 |
| 4-Phenylthiazole-2-carboxylic acid | 59020-44-9 | 2A-9045098 |
| 2-Mercaptomethylpyrazine | 59021-02-2 | 2A-9045101 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA