
CAS Number58349-17-0
Synonyms(2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine,hydrochloride; (2S)-5-Methoxy-1,2,3,4-tetrahydro-2-naphthalenamine hydrochloride (1:1); 2-Naphthalenamine, 1,2,3,4-tetrahydro-5-methoxy-, (2S)-, hydrochloride (1:1)
Molecular FormulaC11H16ClNO
Molecular Weight213.704
Purity98.00%
Boiling Point295.7°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58349-17-0 |
| Catalog No. | 2A-9044981 |
| Chinese Name | 罗替戈汀中间体一 |
| Synonyms | (2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine,hydrochloride; (2S)-5-Methoxy-1,2,3,4-tetrahydro-2-naphthalenamine hydrochloride (1:1); 2-Naphthalenamine, 1,2,3,4-tetrahydro-5-methoxy-, (2S)-, hydrochloride (1:1) |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.704 |
| Purity | 98.00 |
| Boiling Point | 295.7°C |
| Storage Condition | room temperature, dry |
| HTC | 2932999099 |
| PubChem ID | 89388220 |
| SMILES | COc1cccc2c1CCC(N)C2.Cl |
| InChI | InChI=1S/C11H15NO.ClH/c1-13-11-4-2-3-8-7-9(12)5-6-10(8)11;/h2-4,9H,5-7,12H2,1H3;1H/t9-;/m0./s1 |
| InChI Key | CGLCAQWQPIFKRX-FVGYRXGTSA-N |
| MSDS | msds/44981_1_58349_17_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 2-Chloromethylimidazo[1,2-a]pyridine hydrochloride | 57892-76-9 | 2A-9044924 |
| Potassium (R)-((3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino)(4-hydroxyphenyl)acetate | 57938-86-0 | 2A-9044929 |
| 7-(Diethylamino)-3-(5,6-dimethyl-2-benzoxazolyl)-2H-1-benzopyran-2-one | 57980-76-4 | 2A-9044934 |
| N-Fmoc-N'-nitro-L-arginine | 58111-94-7 | 2A-9044951 |
| (S)-2-Pyrrolidinecarboxamide | 58274-20-7 | 2A-9044971 |
| (S)-5-Methoxy-1,2,3,4-tetrahydro-N-(phenylmethyl)-2-naphthalenamine | 58349-23-8 | 2A-9044982 |
| (S)-Methyl 2-N-Cbz-3-N-Boc-propanoate | 58457-98-0 | 2A-9044994 |
| Benzyl 4-oxo-2-(S)-[[(phenylmethoxy)carbonyl]amino]butanoate | 58578-45-3 | 2A-9045026 |
| 3-Maleimidobenzoic acid N-hydroxysuccinimide ester | 58626-38-3 | 2A-9045038 |
| (R)-2-(4-Methoxyphenyl)-1-methylethanamine | 58993-79-6 | 2A-9045094 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA