
CAS Number57842-10-1
Synonyms3-Iodoisonicotinic acid; 3-Iodo-4-pyridinecarboxylic acid; MFCD01646072
Molecular FormulaC6H4O2N1I1
Molecular Weight249.01
Purity98.00%
Density2.1±0.1 g/cm3
Boiling Point435.7±30.0 °C at 760 mmHg
Melting Point205-210ºC
AppearancePowder | Off-white to beige
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57842-10-1 |
| Catalog No. | 2A-9044915 |
| Chinese Name | 3-碘异烟酸 |
| Synonyms | 3-Iodoisonicotinic acid; 3-Iodo-4-pyridinecarboxylic acid; MFCD01646072 |
| Molecular Formula | C6H4O2N1I1 |
| Molecular Weight | 249.01 |
| Purity | 98.00 |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 435.7±30.0 °C at 760 mmHg |
| Melting Point | 205-210ºC |
| Appearance | Powder | Off-white to beige |
| Storage Condition | Keep Cold |
| HTC | 2933399090 |
| PubChem ID | 3190651 |
| MDL Number | MFCD01646072 |
| SMILES | O=C(O)c1ccncc1I |
| InChI | InChI=1S/C6H4INO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3H,(H,9,10) |
| InChI Key | MJSNRTLYWDXHAQ-UHFFFAOYSA-N |
| MSDS | msds/44915_1_57842_10_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Bromophenyl)propionitrile | 57775-08-3 | 2A-9044899 |
| 8-Chloroquinolin-4-ol | 57797-97-4 | 2A-9044903 |
| 8-Bromo-4-quinolinol | 57798-00-2 | 2A-9044904 |
| 1-Bromo-2-cyclopropylbenzene | 57807-28-0 | 2A-9044906 |
| Stevioside | 57817-89-7 | 2A-9044910 |
| Calcium bis(dinonylnaphthalenesulphonate) | 57855-77-3 | 2A-9044919 |
| 2-Amino-1-(4-chlorophenyl)propan-1-ol | 57908-21-1 | 2A-9044926 |
| 3-Acetoxy-2-cyclohexen-1-one | 57918-73-7 | 2A-9044927 |
| Isopropenyl chloroformate | 57933-83-2 | 2A-9044928 |
| 3-Pyridin-3-ylaniline | 57976-57-5 | 2A-9044933 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA