
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57338-76-8 |
| Catalog No. | 2A-0202008 |
| Chinese Name | 2,5-二甲基吡咯-3-羧酸 |
| Synonyms | MFCD00203874; 2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 |
| Purity | 98.00 |
| Density | 1.233g/cm3 |
| Boiling Point | 318.4ºC at 760mmHg |
| Melting Point | 200 °C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933990090 |
| PubChem ID | 436209 |
| SMILES | Cc1cc(C(=O)O)c(C)[nH]1 |
| InChI | InChI=1S/C7H9NO2/c1-4-3-6(7(9)10)5(2)8-4/h3,8H,1-2H3,(H,9,10)/p-1 |
| InChI Key | VDVWTJFVFQVCFN-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Bromo-7-chloro-2-(trifluoromethyl)quinoline | 57124-19-3 | 2A-9044769 |
| 6-Methoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride | 57196-62-0 | 2A-9044776 |
| 1-Phenyl-1H-[1,2,4]triazole-3-carboxylic acid methyl ester | 57226-96-7 | 2A-9044782 |
| 2-Mercapto-4,6-dimethoxypyrimidine | 57235-35-5 | 2A-9044786 |
| 1-(3,4-Dichlorophenyl)piperazine | 57260-67-0 | 2A-9044789 |
| Ethyl 2-thiopheneacetate | 57382-97-5 | 2A-9044824 |
| 4-Fluoropiperidine hydrochloride | 57395-89-8 | 2A-9044825 |
| 6-Hydroxyimidazo[1,2-b]pyridazine | 57470-54-9 | 2A-9044839 |
| 5,7-Dichloropyrazolo[1,5-a]pyrimidine | 57489-77-7 | 2A-9044847 |
| 6-Benzyloxypurine | 57500-07-9 | 2A-9044851 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA