
CAS Number161622-05-5
SynonymsMFCD00061293; α,α,α,5-Tetrafluoro-m-toluic acid; QVR CF EXFFF; 3-fluoro-5-trifluoromethylbenzoic acid; 3-Fluoro-5-(trifluoromethyl)benzoic acid
Molecular FormulaFC6H3(CF3)CO2H
Molecular Weight208.11
Purity98%
Density1.5±0.1 g/cm3
Boiling Point239.6±40.0 °C at 760 mmHg
Melting Point104-108 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 161622-05-5 |
| Catalog No. | 2A-9004481 |
| Chinese Name | 3-氟-5-三氟甲基苯甲酸 |
| Synonyms | MFCD00061293; α,α,α,5-Tetrafluoro-m-toluic acid; QVR CF EXFFF; 3-fluoro-5-trifluoromethylbenzoic acid; 3-Fluoro-5-(trifluoromethyl)benzoic acid |
| Molecular Formula | FC6H3(CF3)CO2H |
| Molecular Weight | 208.11 |
| Purity | 98 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 239.6±40.0 °C at 760 mmHg |
| Melting Point | 104-108 °C (lit.) |
| Appearance | solid |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2916399090 |
| PubChem ID | 24869055 |
| MDL Number | MFCD00061293 |
| SMILES | OC(=O)c1cc(F)cc(c1)C(F)(F)F |
| InChI | 1S/C8H4F4O2/c9-6-2-4(7(13)14)1-5(3-6)8(10,11)12/h1-3H,(H,13,14) |
| InChI Key | NSGKIIGVPBTOBF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/4481_1_161622_05_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Fluoro-4-iodobenzaldehyde | 1003709-57-6 | 2A-9004459 |
| 3-Fluoro-4-methoxybenzaldehyde | 351-54-2 | 2A-9004465 |
| 3-Fluoro-4-methoxyphenylboronic acid | 149507-26-6 | 2A-9004470 |
| 3-Fluoro-4-methylbenzaldehyde | 177756-62-6 | 2A-9004473 |
| 3-Fluoro-5-(trifluoromethyl)aniline | 454-67-1 | 2A-9004480 |
| 3-Fluoro-5-(trifluoromethyl)benzonitrile | 149793-69-1 | 2A-9004482 |
| 3-Fluoro-5-methylbenzaldehyde | 2A-104485 | 2A-9004485 |
| 3-Formylphenylboronic acid | 87199-16-4 | 2A-9004511 |
| 3'-Hydroxy biphenyl-2-carbaldehyde | 400750-67-6 | 2A-9004520 |
| 3'-Hydroxy biphenyl-2-carboxylic acid | 92379-10-7 | 2A-9004521 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA