
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56674-87-4 |
| Catalog No. | 2A-9044682 |
| Chinese Name | 2-金刚烷酮-5-甲酸 |
| Synonyms | 4-Oxoadamantane-1-carboxylic acid; 4-Oxo-1-adamantanecarboxylic acid |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 367.6±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, sealed |
| HTC | 2918300090 |
| PubChem ID | 3329768 |
| SMILES | O=C1C2CC3CC1CC(C(=O)O)(C3)C2 |
| InChI | InChI=1S/C11H14O3/c12-9-7-1-6-2-8(9)5-11(3-6,4-7)10(13)14/h6-8H,1-5H2,(H,13,14) |
| InChI Key | VFNJWHFPIRNNRQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Bromomethyl-3-nitrobenzoic acid | 55715-03-2 | 2A-9044462 |
| 5-Acenaphthenecarboxylic acid | 55720-22-4 | 2A-9044468 |
| Chloromethylstyrene-divinylbenzene-styrene copolymer | 55844-94-5 | 2A-9044510 |
| 3-(4-(Trifluoromethyl)phenoxy)-N,N-dimethyl-3-phenylpropan-1-amine | 56225-81-1 | 2A-9044576 |
| Ketoketal | 56309-94-5 | 2A-9044595 |
| 4-Ethoxy-3-methylbenzaldehyde | 56917-14-7 | 2A-9044719 |
| 2,3,5-Trichlorobenzaldehyde | 56961-75-2 | 2A-9044727 |
| 3,5-Dibromobenzaldehyde | 56990-02-4 | 2A-9044743 |
| 2-Methoxy-4-methylbenzaldehyde | 57415-35-7 | 2A-9044827 |
| 2-Phenyl-2H-1-benzopyran-3-carboxaldehyde | 57543-47-2 | 2A-9044859 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA