
CAS Number56619-93-3
Synonyms3-methoxy-N-pivalanilide; N-pivaloyl-m-anisidine; N-(3-methoxyphenyl)pivalamide; Propanamide,N-(3-methoxyphenyl)-2,2-dimethyl; N-(3-METHOXYPHENYL)-2,2-DIMETHYLPROPANAMIDE; N1-(3-methoxyphenyl)-2,2-dimethylpropanamide; N-(3-methoxyphenyl)-2,2-dimethylpropionamide; m-methoxypivanilide; 3-methoxy-N-pivaloylaniline; N-(2,2-Dimethylpropanoyl)-3-(methoxy)aniline
Molecular FormulaC12H17NO2
Molecular Weight207.27
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point358.2±25.0 °C at 760 mmHg
Melting Point125-126ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56619-93-3 |
| Catalog No. | 2A-9044668 |
| Chinese Name | 3-特戊酰胺苯甲醚 |
| Synonyms | 3-methoxy-N-pivalanilide; N-pivaloyl-m-anisidine; N-(3-methoxyphenyl)pivalamide; Propanamide,N-(3-methoxyphenyl)-2,2-dimethyl; N-(3-METHOXYPHENYL)-2,2-DIMETHYLPROPANAMIDE; N1-(3-methoxyphenyl)-2,2-dimethylpropanamide; N-(3-methoxyphenyl)-2,2-dimethylpropionamide; m-methoxypivanilide; 3-methoxy-N-pivaloylaniline; N-(2,2-Dimethylpropanoyl)-3-(methoxy)aniline |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 358.2±25.0 °C at 760 mmHg |
| Melting Point | 125-126ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2924299090 |
| PubChem ID | 3211075 |
| SMILES | COc1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C12H17NO2/c1-12(2,3)11(14)13-9-6-5-7-10(8-9)15-4/h5-8H,1-4H3,(H,13,14) |
| InChI Key | DAFHCFQPQMYDFI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2-Oxo-2H-pyridin-1-yl)acetic acid | 56546-36-2 | 2A-9044652 |
| Sodium triacetoxyborohydride | 56553-60-7 | 2A-9044654 |
| N-Cyano-N'-methyl-ethanimidamide | 56563-12-3 | 2A-9044655 |
| 1,4-Pentadiyn-3-ol | 56598-53-9 | 2A-9044660 |
| Benzotriazol-1-yloxytris(dimethylamino)-phosphonium hexafluorophosphate | 56602-33-6 | 2A-9044663 |
| 2-Methoxypyrimidin-5-amine | 56621-89-7 | 2A-9044670 |
| 4-(1H-Imidazol-1-ylmethyl)aniline | 56643-85-7 | 2A-9044673 |
| 1-(1H-Benzimidazol-2-yl)-2,2-dibromoethanone | 56653-42-0 | 2A-9044677 |
| Bis(tetrabutylammonium) dichromate | 56660-19-6 | 2A-9044678 |
| 3-Bromocyclohex-2-enone | 56671-81-9 | 2A-9044679 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA