
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55499-43-9 |
| Catalog No. | 2A-9044417 |
| Chinese Name | 3,4-二甲基苯硼酸 |
| Synonyms | (3,4-Dimethylphenyl)boronic acid; MFCD01009694 |
| Molecular Formula | C8H11BO2 |
| Molecular Weight | 149.99 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 304.9±52.0 °C at 760 mmHg |
| Melting Point | 220°C |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Seal and store at 0-6 ºC |
| HTC | 2931900090 |
| PubChem ID | 3155152 |
| SMILES | Cc1ccc(B(O)O)cc1C |
| InChI | InChI=1S/C8H11BO2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-5,10-11H,1-2H3 |
| InChI Key | KDVZJKOYSOFXRV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 8-Amino-1,4-dioxaspiro[4.5]decane-8-carboxylic acid | 54621-18-0 | 2A-9044240 |
| Tartaric acid dihydrazide | 54789-92-3 | 2A-9044274 |
| Nonanal diethyl acetal | 54815-13-3 | 2A-9044278 |
| Octanal diethyl acetal | 54889-48-4 | 2A-9044287 |
| 3-Aminoisonicotinaldehyde | 55279-29-3 | 2A-9044359 |
| 2,4-Dimethylphenylboronic acid | 55499-44-0 | 2A-9044418 |
| 3-Furanboronic acid | 55552-70-0 | 2A-9044426 |
| 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarboxylic acid | 55701-03-6 | 2A-9044459 |
| 4-Bromomethyl-3-nitrobenzoic acid | 55715-03-2 | 2A-9044462 |
| 5-Acenaphthenecarboxylic acid | 55720-22-4 | 2A-9044468 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA