
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55418-27-4 |
| Catalog No. | 2A-9044398 |
| Chinese Name | 邻氟苄氧胺 |
| Synonyms | 1-(2-Fluorophenyl)-N-hydroxymethanamine; O-(2-Fluorobenzyl)hydroxylamine |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.143 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 254.4±42.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922199090 |
| PubChem ID | 622153 |
| SMILES | NOCc1ccccc1F |
| InChI | InChI=1S/C7H8FNO/c8-7-4-2-1-3-6(7)5-10-9/h1-4H,5,9H2 |
| InChI Key | OUHKQMQWIDUZDW-UHFFFAOYSA-N |
| MSDS | msds/44398_1_55418_27_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Choline tosylate | 55357-38-5 | 2A-9044385 |
| 9-Bromo-1-nonanol | 55362-80-6 | 2A-9044387 |
| 4-Bromobenzamidine hydrochloride | 55368-42-8 | 2A-9044389 |
| 4-(Octyloxy)cinnamic acid | 55379-97-0 | 2A-9044390 |
| Bis(3,4-dimethylphenyl)amine | 55389-75-8 | 2A-9044391 |
| Ethyl 2-dimethylaminobenzoate | 55426-74-9 | 2A-9044401 |
| 2-[(4-Carboxymethylphenoxy)methyl]benzoic acid | 55453-89-9 | 2A-9044405 |
| Mollugin | 55481-88-4 | 2A-9044412 |
| 3-Benzyloxy-4-methoxy-beta-nitrostyrene | 55507-05-6 | 2A-9044420 |
| L-1-Naphthylalanine | 55516-54-6 | 2A-9044422 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA