CAS Number99469-99-5
Synonyms3-Ethoxy-4-(ethoxycarbonyl)phenylacetic acid; 3-Ethoxy-4-(ethoxycarbonyl)benzeneacetic acid; MFCD08704233; QV1R CO2 DVO2; EINECS 427-630-2; Ethyl 4-(carboxymethyl)-2-ethoxybenzoate; [3-Ethoxy-4-(ethoxycarbonyl)phenyl]acetic acid; 2-(3-ethoxy-4-ethoxycarbonylphenyl)acetic acid
Molecular FormulaC13H16O5
Molecular Weight252.26
Purity98%
Density1.2±0.1 g/cm3
Boiling Point414.8±35.0 °C at 760 mmHg
Melting Point78-80ºC
AppearanceWhite to light yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 99469-99-5 |
| Catalog No. | 2A-9004437 |
| Chinese Name | 4-乙氧羰基-3-乙氧基苯乙酸 |
| Synonyms | 3-Ethoxy-4-(ethoxycarbonyl)phenylacetic acid; 3-Ethoxy-4-(ethoxycarbonyl)benzeneacetic acid; MFCD08704233; QV1R CO2 DVO2; EINECS 427-630-2; Ethyl 4-(carboxymethyl)-2-ethoxybenzoate; [3-Ethoxy-4-(ethoxycarbonyl)phenyl]acetic acid; 2-(3-ethoxy-4-ethoxycarbonylphenyl)acetic acid |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.26 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 414.8±35.0 °C at 760 mmHg |
| Melting Point | 78-80ºC |
| Appearance | White to light yellow solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Refrigerator |
| HTC | 2942000000 |
| MDL Number | MFCD08704233 |
| SMILES | O(CC)c1c(ccc(c1)CC(=O)O)C(=O)OCC |
| InChI | 1S/C13H16O5/c1-3-17-11-7-9(8-12(14)15)5-6-10(11)13(16)18-4-2/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
| InChI Key | OTGSESBEJUHCES-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/4437_1_99469_99_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-(3-ethoxy-4-ethoxycarbonylphenyl)acetic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Cyanochromone | 50743-17-4 | 2A-9004419 |
| 3-Cyanophenacyl bromide | 50916-55-7 | 2A-9004422 |
| 3-Cyclopentyloxy-4-methoxybenzonitrile | 159783-16-1 | 2A-9004430 |
| 3-Dimethylaminobenzyl alcohol | 23501-93-1 | 2A-9004433 |
| 3-Ethoxy thiophenol | 86704-82-7 | 2A-9004435 |
| 3-Ethyl-4-fluorophenyl-3-oxopropanoate | 2A-104439 | 2A-9004439 |
| 3-Ethyl-5-(2-hydroxyethyl)-4-methylthiazolium bromide | 54016-70-5 | 2A-9004440 |
| CHAPSO | 82473-24-3 | 2A-9004441 |
| 3-Ethylacetophenone | 22699-70-3 | 2A-9004442 |
| 3-Ethylamino-4-methylphenol | 120-37-6 | 2A-9004444 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS