
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54454-10-3 |
| Catalog No. | 2A-9044208 |
| Chinese Name | 5-氯-1,3-二甲基吡唑 |
| Synonyms | MFCD00051650; 5-chloro-1,3-dimethylpyrazole |
| Molecular Formula | C5H7N2Cl1 |
| Molecular Weight | 130.58 |
| Purity | 98.00 |
| Density | 1,137 g/cm3 |
| Boiling Point | 60-62 °C (15 mmHg) |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933199090 |
| PubChem ID | 3140736 |
| MDL Number | MFCD00051650 |
| SMILES | Cc1cc(Cl)n(C)n1 |
| InChI | InChI=1S/C5H7ClN2/c1-4-3-5(6)8(2)7-4/h3H,1-2H3 |
| InChI Key | DDUSLFAWARYAPR-UHFFFAOYSA-N |
| MSDS | msds/44208_1_54454_10_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Chloro-2-(methylthio)pyrazolo[1,5-a][1,3,5]triazine | 54346-19-9 | 2A-9044182 |
| 2-Amino-5-methoxybenzothiazole | 54346-87-1 | 2A-9044183 |
| 2-Amino-5-iodo-3-pyridinecarboxylic acid | 54400-30-5 | 2A-9044195 |
| 5-Amino-3-methylisoquinoline | 54410-17-2 | 2A-9044202 |
| 2-Bromo-4-ethylpyridine | 54453-91-7 | 2A-9044206 |
| 2-Pyrrolidone-5-carboxylic acid sodium salt | 54571-67-4 | 2A-9044228 |
| 1-Phenyl-1H-pyrazole-4-carboxaldehyde | 54605-72-0 | 2A-9044234 |
| 2-Hydrazinopyrazine | 54608-52-5 | 2A-9044235 |
| Thiophene-2-carboxamidine hydrochloride | 54610-70-7 | 2A-9044236 |
| 2-Bromo-1H-benzimidazole | 54624-57-6 | 2A-9044242 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA