
CAS Number54256-41-6
SynonymsCyclopropyl({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid; butoxycarbonylamino-cyclopropyl-acetic acid; [(tert-Butoxycarbonyl)amino](cyclopropyl)acetic acid
Molecular FormulaC10H17O4N1
Molecular Weight215.25
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point364.7±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54256-41-6 |
| Catalog No. | 2A-9044165 |
| Chinese Name | N-叔丁氧羰基-环丙基甘氨酸 |
| Synonyms | Cyclopropyl({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid; butoxycarbonylamino-cyclopropyl-acetic acid; [(tert-Butoxycarbonyl)amino](cyclopropyl)acetic acid |
| Molecular Formula | C10H17O4N1 |
| Molecular Weight | 215.25 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 364.7±25.0 °C at 760 mmHg |
| Storage Condition | 2-8℃, dry and away from light |
| HTC | 2924299090 |
| PubChem ID | 39211589 |
| MDL Number | MFCD01861823 |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H17NO4/c1-10(2,3)15-9(14)11-7(8(12)13)6-4-5-6/h6-7H,4-5H2,1-3H3,(H,11,14)(H,12,13) |
| InChI Key | QFVJNEASAAJIDF-UHFFFAOYSA-N |
| MSDS | msds/44165_1_54256_41_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-(+)-1,2,3,4-Tetrahydro-1-naphthol | 53732-47-1 | 2A-9044049 |
| (S)-1-Phenylethylhydroxylamine | 53933-47-4 | 2A-9044082 |
| (R)-2-Amino-2,3-dimethylbutanoic acid | 53940-82-2 | 2A-9044087 |
| (S)-2-Amino-2,3-dimethylbutanoic acid | 53940-83-3 | 2A-9044088 |
| (S)-2-(Benzyloxycarbonylamino)-2-phenylacetic acid | 53990-33-3 | 2A-9044098 |
| 3-Amino-3-azabicyclo[3.3.0]octane | 54528-00-6 | 2A-9044221 |
| 4-Bromo-1,8-naphthyridine | 54569-28-7 | 2A-9044227 |
| (S)-(-)-1-(4-Pyridyl)ethanol | 54656-96-1 | 2A-0202138 |
| (S)-(-)-4-tert-Butyl-2-oxazolidinone | 54705-42-9 | 2A-9044258 |
| (S)-3-Amino-3-(4-hydroxyphenyl)propionic acid | 54732-46-6 | 2A-9044264 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA