CAS Number53746-45-5
SynonymsFenoprofen calcium dihydrate; Calcium 2-(3-phenoxyphenyl)propanoate hydrate (1:2:2); MFCD00242722; Nalgesic; calcium,2-(3-phenoxyphenyl)propanoate,dihydrate; Fenoprofen Calcium Salt Dihydrate; Fenopron; EINECS 252-107-9; Benzeneacetic acid, α-methyl-3-phenoxy-, calcium salt, hydrate (2:1:1); Nalfon
Molecular FormulaC30H26O6Ca
Molecular Weight522.60
Purity≥97 (HPLC)%
Density1.17
Boiling Point104 °C
Melting Point-40 °C
AppearanceColorless transparent liquid. The boiling point is 104.5℃, the relative density is 1.1744, the flash
EINECS252-107-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53746-45-5 |
| Catalog No. | 2A-9044051 |
| Chinese Name | 非诺洛芬钙二水合物 |
| Synonyms | Fenoprofen calcium dihydrate; Calcium 2-(3-phenoxyphenyl)propanoate hydrate (1:2:2); MFCD00242722; Nalgesic; calcium,2-(3-phenoxyphenyl)propanoate,dihydrate; Fenoprofen Calcium Salt Dihydrate; Fenopron; EINECS 252-107-9; Benzeneacetic acid, α-methyl-3-phenoxy-, calcium salt, hydrate (2:1:1); Nalfon |
| Molecular Formula | C30H26O6Ca |
| Molecular Weight | 522.60 |
| Purity | ≥97 (HPLC) |
| Density | 1.17 |
| Boiling Point | 104 °C |
| Melting Point | -40 °C |
| Appearance | Colorless transparent liquid. The boiling point is 104.5℃, the relative density is 1.1744, the flash |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 252-107-9 |
| PubChem ID | 329799683 |
| MDL Number | MFCD00242722 |
| SMILES | O.[Ca].CC(C(O)=O)c1cccc(Oc2ccccc2)c1 |
| InChI | 1S/C15H14O3.Ca.H2O.2H/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13;;;;/h2-11H,1H3,(H,16,17);;1H2;; |
| InChI Key | JWCQUXFJNIIYQZ-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/44051_1_53746_45_5.pdf |
| Transport Info | Product name: Fenoprofen calcium dihydrate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Armillarisin A | 53696-74-5 | 2A-9044041 |
| Leuprorelin | 53714-56-0 | 2A-9044043 |
| Ethyl viologen dibromide | 53721-12-3 | 2A-9044047 |
| 2-Aminobutanamide | 53726-14-0 | 2A-9044048 |
| Methyl 3-[(3-methoxy-3-oxopropyl)phenylamino]propanoate | 53733-94-1 | 2A-9044050 |
| 2-Chloropropane-2-D1 | 53778-42-0 | 2A-9044053 |
| 2-Fluoro-3-(4-hydroxyphenyl)propanoic acid | 53786-98-4 | 2A-9044057 |
| Ribostamycin sulfate | 53797-35-6 | 2A-9044059 |
| Viaminate | 53839-71-7 | 2A-9044062 |
| Dimethyldiphenylthiuram disulfide | 53880-86-7 | 2A-9044071 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS