
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53324-38-2 |
| Catalog No. | 2A-9043961 |
| Chinese Name | 4-溴-3-硝基苯胺 |
| Synonyms | MFCD01320678; 4-Bromo-3-nitroaniline |
| Molecular Formula | C7H7BrN2O3 |
| Molecular Weight | 247.049 |
| Purity | 98.00 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 299.7±20.0 °C at 760 mmHg |
| Melting Point | 128-132ºC |
| Appearance | Orange to dark brown crystalline powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2921420090 |
| PubChem ID | 3153055 |
| MDL Number | MFCD00031127 |
| SMILES | Nc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H5BrN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2 |
| InChI Key | PITHQPMZWKZGRZ-UHFFFAOYSA-N |
| MSDS | msds/43961_1_53324_38_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Bromo-1-adamantanecarboxamide | 53263-89-1 | 2A-9043944 |
| 3,5-Diiodobenzyl alcohol | 53279-79-1 | 2A-9043948 |
| 3-Methyl-4-aminobenzensulfonamide | 53297-70-4 | 2A-9043952 |
| Bis(2-propylheptyl) phthalate | 53306-54-0 | 2A-9043954 |
| 4-Amino-2-fluorobenzonitrile | 53312-80-4 | 2A-9043957 |
| 1-(1H-Imidazol-2-yl)methanamine | 53332-80-2 | 2A-9043964 |
| 3,3'-Dipropylthiacarbocyanine iodide | 53336-12-2 | 2A-9043965 |
| 4-Mercaptobenzyl alcohol | 53339-53-0 | 2A-9043966 |
| Nile Blue A perchlorate | 53340-16-2 | 2A-9043967 |
| 9,10-Diaminophenanthrene | 53348-04-2 | 2A-9043969 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA