
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53012-41-2 |
| Catalog No. | 2A-9043884 |
| Chinese Name | 1-(2`,6`-二甲氧基)-2-丙酮 |
| Synonyms | 1-(2,6-dimethylphenoxy)propan-2-one |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| Purity | 98.00 |
| Density | 1.011 g/cm3 |
| Boiling Point | 261.4ºC at 760 mmHg |
| Appearance | Light yellow to yellow-brown liquid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2914509090 |
| PubChem ID | 10233393 |
| MDL Number | MFCD00130266 |
| SMILES | CC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C11H14O2/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6H,7H2,1-3H3 |
| InChI Key | XDJULAUHYAJQBU-UHFFFAOYSA-N |
| MSDS | msds/43884_1_53012_41_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Prosulfocarb | 52888-80-9 | 2A-9043870 |
| 4,N-Dimethoxy-N-methylbenzamide | 52898-49-4 | 2A-9043871 |
| 6-Cyano-2-naphthol | 52927-22-7 | 2A-9043875 |
| Caulophyllogenin | 52936-64-8 | 2A-9043876 |
| 2-Chloro-N,N-dimethylnicotinamide | 52943-21-2 | 2A-9043877 |
| 5,6-Dihydro-4H-cyclopentathiazol-2-ylamine | 53051-97-1 | 2A-9043887 |
| 2,3,4,5-Tetrafluorobenzyl alcohol | 53072-18-7 | 2A-9043893 |
| 4-Hydroxymethylbenzocyclobutene | 53076-11-2 | 2A-9043894 |
| 6,8-Dimethoxyl-2-tetralone | 53076-59-8 | 2A-9043895 |
| 2-Methoxy-5-methylbenzonitrile | 53078-70-9 | 2A-9043896 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA