CAS Number52591-27-2
SynonymsAcrylic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester; Propenoic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester; Acrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester; 1H,1H,2H,2H-Nonafluorohexyl Acrylate; 2-Propenoic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester; 1H,1H,2H,2H-Perfluorohexyl acrylate; 1H,1H,2H,2H-Nonafluorohexyl acrylate; 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Acrylate; DAIKIN R-1420; 3,3,4,4,5,5,6,6,6-Nonafluorohexylacrylate
Molecular FormulaC9H7F9O2
Molecular Weight318.14
Purity98.00%
Density1.414
Boiling Point164ºC
AppearanceLiquid;Colorless to Light yellow clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52591-27-2 |
| Catalog No. | 2A-9043805 |
| Chinese Name | 丙烯酸1H,1H,2H,2H-九氟己酯 |
| Synonyms | Acrylic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester; Propenoic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester; Acrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester; 1H,1H,2H,2H-Nonafluorohexyl Acrylate; 2-Propenoic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester; 1H,1H,2H,2H-Perfluorohexyl acrylate; 1H,1H,2H,2H-Nonafluorohexyl acrylate; 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Acrylate; DAIKIN R-1420; 3,3,4,4,5,5,6,6,6-Nonafluorohexylacrylate |
| Molecular Formula | C9H7F9O2 |
| Molecular Weight | 318.14 |
| Purity | 98.00 |
| Density | 1.414 |
| Boiling Point | 164ºC |
| Appearance | Liquid;Colorless to Light yellow clear liquid |
| Storage Condition | room temperature |
| Packaging | III |
| HTC | 2916129000 |
| PubChem ID | 3211861 |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F9O2/c1-2-5(19)20-4-3-6(10,11)7(12,13)8(14,15)9(16,17)18/h2H,1,3-4H2 |
| InChI Key | GYUPEJSTJSFVRR-UHFFFAOYSA-N |
| Hazard Symbols | Category 3 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 3272 Formal shipping name: Ester, not otherwise specified Packing grade: III |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| Diethylene glycol diglycidyl ether | 39443-66-8 | 2A-9042322 |
| 1,2-Dimethylisothiourea hydriodate | 41306-45-0 | 2A-9042768 |
| Dipropyleneglycol diglycidyl ether | 41638-13-5 | 2A-9042821 |
| 2-Phenoxyethyl acrylate | 48145-04-6 | 2A-9043167 |
| Trimethylolpropane tris(3-aziridinylpropanoate) | 52234-82-9 | 2A-9043707 |
| Trimethylolpropane propoxylate triacrylate | 53879-54-2 | 2A-9044070 |
| alpha-Amino-gamma-oxo-benzenebutanoic acid hydrochloride | 54631-37-7 | 2A-9044244 |
| Triethylene glycol monobenzyl ether | 55489-58-2 | 2A-9044414 |
| 2,2-Bis(4-hydroxyphenyl)adamantane diglycidyl ether | 56323-07-0 | 2A-9044597 |
| 3-Methylhexahydrophthalic anhydride | 57110-29-9 | 2A-9044765 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS