
CAS Number52479-85-3
SynonymsEINECS 257-945-9; 3,4,5,2',3',4'-Hexahydroxybenzophenone; (2,3,4-Trihydroxyphenyl)(3,4,5-trihydroxyphenyl)methanone; (2,3,4-trihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone; MFCD00082966
Molecular FormulaC13H10O7
Molecular Weight278.22
Purity98.00%
Density1.759 g/cm3
Boiling Point674.6ºC at 760 mmHg
Melting Point245°C
Appearanceyellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52479-85-3 |
| Catalog No. | 2A-9043772 |
| Chinese Name | 依昔苯酮 |
| Synonyms | EINECS 257-945-9; 3,4,5,2',3',4'-Hexahydroxybenzophenone; (2,3,4-Trihydroxyphenyl)(3,4,5-trihydroxyphenyl)methanone; (2,3,4-trihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone; MFCD00082966 |
| Molecular Formula | C13H10O7 |
| Molecular Weight | 278.22 |
| Purity | 98.00 |
| Density | 1.759 g/cm3 |
| Boiling Point | 674.6ºC at 760 mmHg |
| Melting Point | 245°C |
| Appearance | yellow solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914501900 |
| PubChem ID | 518592 |
| MDL Number | MFCD00082966 |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C13H10O7/c14-7-2-1-6(11(18)13(7)20)10(17)5-3-8(15)12(19)9(16)4-5/h1-4,14-16,18-20H |
| InChI Key | XEDWWPGWIXPVRQ-UHFFFAOYSA-N |
| MSDS | msds/43772_1_52479_85_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2-Methylthiazol-5-yl)acetic acid | 52454-65-6 | 2A-9043765 |
| Dichloro(p-cymene)ruthenium(II) dimer | 52462-29-0 | 2A-9043766 |
| Trihexadecyl methyl ammonium chloride | 52467-63-7 | 2A-9043767 |
| 3-Propeneamido-1-(2,4,6-trichlorophenyl)-5-pyrazolone | 52472-98-7 | 2A-9043769 |
| Precyclemone B | 52474-60-9 | 2A-9043770 |
| 4-Nitrophenyl phosphate bis(cyclohexylammonium) salt | 52483-84-8 | 2A-9043773 |
| D-Tryptophanol | 52485-52-6 | 2A-9043774 |
| Sodium tetrabromoaurate | 52495-41-7 | 2A-9043778 |
| Dikegulac sodium | 52508-35-7 | 2A-9043783 |
| 4-Methoxy-2(1H)-pyridinone | 52545-13-8 | 2A-9043790 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA