
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52196-74-4 |
| Catalog No. | 2A-9043689 |
| Chinese Name | 2,5-二乙氧基氯苯 |
| Synonyms | 2,5-Diethoxychlorobenzene; 2-Chloro-1,4-diethoxybenzene; EINECS 257-728-9; MFCD00026765 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.667 |
| Purity | 98.00 |
| Density | 1.14 |
| Boiling Point | 266 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| PubChem ID | 396957 |
| MDL Number | MFCD00026765 |
| SMILES | CCOc1ccc(OCC)c(Cl)c1 |
| InChI | InChI=1S/C10H13ClO2/c1-3-12-8-5-6-10(13-4-2)9(11)7-8/h5-7H,3-4H2,1-2H3 |
| InChI Key | ZIMKMIAIVORSSX-UHFFFAOYSA-N |
| MSDS | msds/43689_1_52196_74_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,4-Bis(tert-butyl)-6-[(2-nitrophenyl)azo]phenol | 52184-14-2 | 2A-9043683 |
| 2,4-Bis(tert-pentyl)-6-[(2-nitrophenyl)azo]phenol | 52184-19-7 | 2A-9043684 |
| 4,6-Di(tert-butyl)-2-[(4-chloro-2-nitrophenyl)azo]phenol | 52184-29-9 | 2A-9043685 |
| Cyclopropanecarboximidic acid ethyl ester | 52186-76-2 | 2A-9043686 |
| 2,5,8,11-Tetraoxatridecane-13-thiol | 52190-55-3 | 2A-9043688 |
| 5-Benzyl-3-pyridinol | 52196-90-4 | 2A-9043690 |
| 4-Propylcyclohexanol | 52204-65-6 | 2A-9043694 |
| Pipecuronium bromide | 52212-02-9 | 2A-0201791 |
| Pygenic acid A | 52213-27-1 | 2A-9043700 |
| 1,8-Bis(triethoxysilyl)octane | 52217-60-4 | 2A-9043703 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA