
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52062-92-7 |
| Catalog No. | 2A-9043654 |
| Chinese Name | 4-(2-溴乙基)苯甲酸 |
| Synonyms | MFCD00016541; 4-(2-Bromoethyl)benzoic acid; EINECS 257-632-7; 4-(2-BROMOETHYL)BENZOICACID |
| Molecular Formula | C9H9O2Br1 |
| Molecular Weight | 229.07 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 332.5±25.0 °C at 760 mmHg |
| Melting Point | 206-208°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2916399090 |
| PubChem ID | 10233244 |
| MDL Number | MFCD00016541 |
| SMILES | O=C(O)c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C9H9BrO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChI Key | BKMRWJWLBHHGCF-UHFFFAOYSA-N |
| MSDS | msds/43654_1_52062_92_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-(2-Bromoethyl)benzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methyl-5-nitropyridin-3-amine | 51984-61-3 | 2A-9043637 |
| Ethyl 2-methyl-5-nitronicotinate | 51984-71-5 | 2A-9043638 |
| Eradicane E | 51990-04-6 | 2A-9043642 |
| 5-Benzyloxytryptamine hydrochloride | 52055-23-9 | 2A-9043652 |
| 3-Fluorophenethyl alcohol | 52059-53-7 | 2A-9043653 |
| 2-(Aminomethyl)phenylacetic acid hydrochloride | 52067-92-2 | 2A-9043656 |
| 4-Benzyloxyphenylhydrazine hydrochloride | 52068-30-1 | 2A-9043657 |
| Potassium [(cyanomethyl)thio]acetate | 52069-54-2 | 2A-9043658 |
| Solvent Violet 8 | 52080-58-7 | 2A-9043660 |
| 3-Amino-6-methoxy-2-picoline | 52090-56-9 | 2A-9043662 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA