
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51959-14-9 |
| Catalog No. | 2A-9043632 |
| Chinese Name | 4-(2,4-二特戊基苯氧基)丁胺 |
| Synonyms | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-1-amine |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.508 |
| Purity | 98.00 |
| Density | 0.917 g/cm3 |
| Boiling Point | 401ºC at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 6409188 |
| MDL Number | MFCD00038526 |
| SMILES | CCC(C)(C)c1ccc(OCCCCN)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C20H35NO/c1-7-19(3,4)16-11-12-18(22-14-10-9-13-21)17(15-16)20(5,6)8-2/h11-12,15H,7-10,13-14,21H2,1-6H3 |
| InChI Key | OZYOAOYHMMDTNZ-UHFFFAOYSA-N |
| MSDS | msds/43632_1_51959_14_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Triadimefon | 43121-43-3 | 2A-9043080 |
| Tris(2,4-dimethylphenyl)phosphine | 49676-42-8 | 2A-9043197 |
| Tris(2,4-Dibromo-phenyl) phosphate | 49690-63-3 | 2A-9043200 |
| 4-(2,4-Di-tert-pentylphenoxy)butyric acid | 50772-35-5 | 2A-9043318 |
| 5-Methoxy-2,4-dinitrophenol | 51652-35-8 | 2A-9043548 |
| 2,4-Dichlorobenzylhydroxylamine | 52370-40-8 | 2A-9043747 |
| 5-Iodo-2,4-dimethoxypyrimidine | 52522-99-3 | 2A-9043787 |
| 2,4-Dimethoxypyrimidine-5-carbaldehyde | 52606-02-7 | 2A-9043814 |
| Deltamethrin | 52820-00-5 | 2A-9043862 |
| 2-(2,4-Dichlorophenoxy)propanoic acid dimethylamine salt | 53404-32-3 | 2A-9043981 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA