
CAS Number51707-38-1
Synonyms3,5-Dimethoxybenzohydrazide; Benzoic acid, 3,5-dimethoxy-, hydrazide; MFCD00017062; 3,5-Dimethoxybenzolcarbohydrazid; 3,5-Dimethoxybenzoyl hydrazine
Molecular FormulaC9H12N2O3
Molecular Weight196.203
Purity98.00%
Density1.2±0.1 g/cm3
Melting Point143-144°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51707-38-1 |
| Catalog No. | 2A-9043562 |
| Chinese Name | 3,5-二甲氧基苄肼 |
| Synonyms | 3,5-Dimethoxybenzohydrazide; Benzoic acid, 3,5-dimethoxy-, hydrazide; MFCD00017062; 3,5-Dimethoxybenzolcarbohydrazid; 3,5-Dimethoxybenzoyl hydrazine |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.203 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Melting Point | 143-144°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2928000090 |
| PubChem ID | 482146 |
| SMILES | COc1cc(OC)cc(C(=O)NN)c1 |
| InChI | InChI=1S/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
| InChI Key | DOWVACHORBOSEF-UHFFFAOYSA-N |
| MSDS | msds/43562_1_51707_38_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2-Nitrophenyl)-1,2-ethanediol | 51673-59-7 | 2A-9043553 |
| Sodium thiophosphate | 51674-17-0 | 2A-9043555 |
| Ethyl 2-nonylacetoacetate | 51688-56-3 | 2A-9043557 |
| 1-Dimethylamino-2-methylpentan-3-one | 51690-03-0 | 2A-9043558 |
| Disodium 3,3'-sulfonylbis(6-chlorobenzenesulfonate) | 51698-33-0 | 2A-9043561 |
| 3,5-Dichlorophenylacetic acid | 51719-65-4 | 2A-9043564 |
| 3-Decyn-1-ol | 51721-39-2 | 2A-9043565 |
| N-[3-(Dipropylamino)phenyl]acetamide | 51732-34-4 | 2A-9043567 |
| 1,8-Dichloro-9,10-bis(phenylethynyl) anthracene | 51749-83-8 | 2A-9043569 |
| 5-(2-Chlorophenyl)-7-bromo-1,4-benzodiazepin-2-one | 51753-57-2 | 2A-9043572 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA