
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51632-28-1 |
| Catalog No. | 2A-9043539 |
| Chinese Name | 4-乙基苯基乙腈 |
| Synonyms | 2-(4-ethylphenyl)acetonitrile; MFCD00040893; 4-ETHYLPHENYLACETONITRILE |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20100 |
| Purity | 98.00 |
| Density | 0,97 g/cm3 |
| Boiling Point | 110°C 1mm |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2926909090 |
| PubChem ID | 6379984 |
| SMILES | CCc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
| InChI Key | NCPKDFDQDZMXCO-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Butyltin oxide | 51590-67-1 | 2A-9043528 |
| 1,3,4,6-Tetrachloro-3a,6a-diphenylglycouril | 51592-06-4 | 2A-9043529 |
| 2'-Chlorodiphenyl-2,3,4,5,6-D5 | 51624-35-2 | 2A-9043534 |
| Cefatrizine | 51627-14-6 | 2A-9043535 |
| 3-Methyl-2-(4-chlorophenyl)butyryl chloride | 51631-50-6 | 2A-9043538 |
| 3-Phenoxyphenylacetonitrile | 51632-29-2 | 2A-9043540 |
| Stearyl chloroformate | 51637-93-5 | 2A-9043541 |
| 6-Aminofluorescein | 51649-83-3 | 2A-9043547 |
| 2-[(2-Nitrophenyl)azo]-4-(1,1,3,3-tetramethylbutyl)phenol | 51656-57-6 | 2A-9043550 |
| 1,2-Bis(2-Nitrophenoxy)ethane | 51661-19-9 | 2A-9043551 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA