
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51135-96-7 |
| Catalog No. | 2A-9043416 |
| Chinese Name | 4-苄基-4-羟基哌啶 |
| Synonyms | 4-Benzylpiperidin-4-ol; 4-BENZYL-4-HYDROXYPIPERIDINE; EINECS 257-003-7; MFCD00023147 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.275 |
| Purity | 98.00 |
| Density | 1.085g/cm3 |
| Boiling Point | 329ºC at 760mmHg |
| Melting Point | 80-85 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933399090 |
| PubChem ID | 121457 |
| MDL Number | MFCD00023147 |
| SMILES | OC1(Cc2ccccc2)CCNCC1 |
| InChI | InChI=1S/C12H17NO/c14-12(6-8-13-9-7-12)10-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2 |
| InChI Key | KJZBZOFESQSBCV-UHFFFAOYSA-N |
| MSDS | msds/43416_1_51135_96_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Propylimidazole | 50995-95-4 | 2A-9043382 |
| 2-(4-Hydroxypenyl)pyridine | 51035-40-6 | 2A-9043399 |
| 1-(6-Pyridazinyl)piperazine | 51047-56-4 | 2A-9043401 |
| 1,2-Dimethyl-1H-indole-3-carbonitrile | 51072-84-5 | 2A-9043404 |
| Ethyl 5-methylisoxazole-4-carboxylate | 51135-73-0 | 2A-9043415 |
| 3,6-Dichloropyridazine-4-carboxylic acid | 51149-08-7 | 2A-9043420 |
| 5-Fluoro-2-hydroxypyridine | 51173-05-8 | 2A-9043423 |
| Methyl-2-deoxy-alpha-D-ribofuranoside | 51255-17-5 | 2A-9043433 |
| Methyl-2-deoxy-beta-D-ribofuranoside | 51255-18-6 | 2A-9043434 |
| Pyridine-2-carboximidamide hydrochloride | 51285-26-8 | 2A-9043440 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA