
CAS Number72235-56-4
Synonyms3-Chloro-4-fluorobenzylamine; MFCD00042507; 1-(3-Chloro-4-fluorophenyl)methanamine; Z1R CG DF; 1-(3-Chloro-4-fluorophenyl)methylamine; (3-chloro-4-fluorophenyl)methanamine; (3-Chloro-4-fluorophenyl)methylamine; 3-Chloro-4-fluorobenzenemethanamine
Molecular FormulaC7H7ClFN
Molecular Weight159.589
Purity97%
Density1.3±0.1 g/cm3
Boiling Point224.8±25.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72235-56-4 |
| Catalog No. | 2A-9004340 |
| Chinese Name | 3-氯-4-氟苄胺 |
| Synonyms | 3-Chloro-4-fluorobenzylamine; MFCD00042507; 1-(3-Chloro-4-fluorophenyl)methanamine; Z1R CG DF; 1-(3-Chloro-4-fluorophenyl)methylamine; (3-chloro-4-fluorophenyl)methanamine; (3-Chloro-4-fluorophenyl)methylamine; 3-Chloro-4-fluorobenzenemethanamine |
| Molecular Formula | C7H7ClFN |
| Molecular Weight | 159.589 |
| Purity | 97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 224.8±25.0 °C at 760 mmHg |
| Storage Condition | Store in a container filled with dry inert gas and |
| Packaging | III |
| HTC | 2921499090 |
| SMILES | NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C7H7ClFN/c8-6-3-5(4-10)1-2-7(6)9/h1-3H,4,10H2 |
| InChI Key | LQAUXDMGRBWDIU-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/4340_1_72235_56_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 2735 Proper Shipping Name: Amine, Liquid, Corrosive, Not Otherwise Specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-4-fluorobenzenesulphonyl chloride | 91170-93-3 | 2A-9004335 |
| 3-Chloro-4-fluorobenzoic acid | 403-16-7 | 2A-9004336 |
| 3-Chloro-4-fluorobenzonitrile | 117482-84-5 | 2A-9004337 |
| 3-Chloro-4-fluorobenzotrifluoride | 78068-85-6 | 2A-9004338 |
| 3-Chloro-4-fluorobenzyl bromide | 192702-01-5 | 2A-9004339 |
| 3-Chloro-4-fluoronitrobenzene | 350-30-1 | 2A-9004341 |
| 3-Chloro-4-fluorophenol | 2613-23-2 | 2A-9004342 |
| 3-Chloro-4-fluorophenylacetic acid | 705-79-3 | 2A-9004344 |
| 3-Chloro-4-fluorophenylhydrazine | 84282-78-0 | 2A-9004346 |
| 3-Chloro-4-fluorophenylhydrazine hydrochloride | 175135-74-7 | 2A-9004347 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA