
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50979-18-5 |
| Catalog No. | 2A-9043378 |
| Chinese Name | 氨基磺酸胍 |
| Synonyms | guanidine sulfamate; EINECS 256-886-6 |
| Molecular Formula | CH8N4O3S |
| Molecular Weight | 156.16400 |
| Purity | 98.00 |
| Boiling Point | 466.3ºC at 760mmHg |
| Melting Point | 128ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature, dry |
| HTC | 2942000000 |
| PubChem ID | 10257528 |
| SMILES | N=C(N)N.NS(=O)(=O)O |
| InChI | InChI=1S/CH5N3.H3NO3S/c2-1(3)4;1-5(2,3)4/h(H5,2,3,4);(H3,1,2,3,4) |
| InChI Key | LNEUSAPFBRDCPM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 35.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Amino-4,5-dichlorobenzoic acid | 50917-30-1 | 2A-9043369 |
| Mizoribine | 50924-49-7 | 2A-9043371 |
| Carminomicin I | 50935-04-1 | 2A-9043373 |
| 4-Ethylaminopent-3-en-2-one | 50967-59-4 | 2A-9043376 |
| 3,5-Diacetamido-2,4,6-triiodobenzoic acid | 50978-11-5 | 2A-9043377 |
| Dichloro(cycloocta-1,5-diene)ruthenium(II) | 50982-12-2 | 2A-9043379 |
| Methyl 2,5-Dibromopentanoate | 50995-48-7 | 2A-9043381 |
| N-Acetylneuraminic acid methyl ester | 50998-13-5 | 2A-9043383 |
| Vinyl neodecanoate | 51000-52-3 | 2A-9043385 |
| Morpholinosulphur trifluoride | 51010-74-3 | 2A-9043386 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA