
CAS Number50803-29-7
Synonyms3-Chlorsulfonyl-4-methoxy-benzoesaeure; 4-methoxy-3-(chlorosulfonyl)benzoic acid; 3-Chlorosulfonyl-4-methoxy-benzoic; 3-Chlorsulfonylanissaeure; 3-chlorosulfonyl-4-methoxy-benzoic acid; 4-Methoxy-3-chlorsulfonyl-benzoesaeure
Molecular FormulaC8H7ClO5S
Molecular Weight250.66
Purity98.00%
Density1.541g/cm3
Boiling Point428.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50803-29-7 |
| Catalog No. | 2A-9043324 |
| Chinese Name | 3-(氯磺酰基)-4-甲氧基苯甲酸 |
| Synonyms | 3-Chlorsulfonyl-4-methoxy-benzoesaeure; 4-methoxy-3-(chlorosulfonyl)benzoic acid; 3-Chlorosulfonyl-4-methoxy-benzoic; 3-Chlorsulfonylanissaeure; 3-chlorosulfonyl-4-methoxy-benzoic acid; 4-Methoxy-3-chlorsulfonyl-benzoesaeure |
| Molecular Formula | C8H7ClO5S |
| Molecular Weight | 250.66 |
| Purity | 98.00 |
| Density | 1.541g/cm3 |
| Boiling Point | 428.8ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918990090 |
| PubChem ID | 5591852 |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H7ClO5S/c1-14-6-3-2-5(8(10)11)4-7(6)15(9,12)13/h2-4H,1H3,(H,10,11) |
| InChI Key | OWBBPHXIAFVUMO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclopentyl chloroformate | 50715-28-1 | 2A-9043311 |
| 3-Piperidinone | 50717-82-3 | 2A-9043312 |
| Methyl 2-amino-5-bromonicotinate | 50735-34-7 | 2A-9043314 |
| 2-Amino-N-(4-bromophenyl)benzamide | 50735-55-2 | 2A-9043315 |
| Polyphyllin A | 50773-41-6 | 2A-9043319 |
| 8-Bromo-1-octanol | 50816-19-8 | 2A-9043325 |
| 3-(Trifluoromethoxy)benzyl alcohol | 50823-90-0 | 2A-9043330 |
| 4-(Trifluoromethoxy)benzyl bromide | 50824-05-0 | 2A-9043333 |
| 1-(2-Hydroxyethyl)-2,3,3-trimethyl-3H-indolium iodide | 50839-66-2 | 2A-9043334 |
| (2-Amino-2-iminoethyl)carbamic acid benzyl ester hydrochloride | 50850-19-6 | 2A-9043337 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA