
CAS Number50670-83-2
Synonyms5-Acetamido-2-aminobenzoic acid; 5-Acetamidoanthranilic Acid; MFCD00060120; EINECS 256-702-4
Molecular FormulaC9H10N2O3
Molecular Weight194.187
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point365.9±32.0 °C at 760 mmHg
Melting Point230°C (dec.)
AppearanceGray to white, moisture sensitive
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50670-83-2 |
| Catalog No. | 2A-9043299 |
| Chinese Name | 5-乙酰氨基邻氨基苯甲酸 |
| Synonyms | 5-Acetamido-2-aminobenzoic acid; 5-Acetamidoanthranilic Acid; MFCD00060120; EINECS 256-702-4 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.187 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 365.9±32.0 °C at 760 mmHg |
| Melting Point | 230°C (dec.) |
| Appearance | Gray to white, moisture sensitive |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| PubChem ID | 4467088 |
| SMILES | CC(=O)Nc1ccc(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H10N2O3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,10H2,1H3,(H,11,12)(H,13,14) |
| InChI Key | GSOHXJQXAKNJES-UHFFFAOYSA-N |
| MSDS | msds/43299_1_50670_83_2.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 5-acetamidoanthranilic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Pentylphenyl 4-methylbenzoate | 50649-59-7 | 2A-9043291 |
| 4-Pentylphenyl 4-propylbenzoate | 50649-60-0 | 2A-9043292 |
| Piroctone | 50650-76-5 | 2A-9043294 |
| 4-Bromo-4'-methylbiphenyl | 50670-49-0 | 2A-9043295 |
| 4-Cyano-4'-methylbiphenyl | 50670-50-3 | 2A-9043296 |
| 4-Methyl-3-nitrolaurophenone | 50671-18-6 | 2A-9043300 |
| Vecuronium bromide | 50700-72-6 | 2A-9043305 |
| 2,5-Dichlorophenylhydrazine hydrochloride | 50709-35-8 | 2A-9043307 |
| 2,6-Dichlorophenylhydrazine hydrochloride | 50709-36-9 | 2A-9043308 |
| 2-(4-Nitrophenyl)propiononitrile | 50712-63-5 | 2A-9043309 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA