![4'-Bromo-[1,1'-biphenyl]-4-carboxaldehyde structure, CAS 50670-58-1](/structures/60000/43297_2_50670_58_1.png)
CAS Number50670-58-1
Synonyms4'-bromo-[1,1'-biphenyl]-4-carboxaldehyde; AMTDA048; 4'-Bromo-4-formylbiphenyl; 4'-bromo-4-biphenylcarboxaldehyde; 4'-BROMO-BIPHENYL-4-CARBALDEHYDE; 4-(4'-bromophenyl)benzaldehyde; 4'-Bromo-[1,1'-biphenyl]-4-carbaldehyde
Molecular FormulaC13H9BrO
Molecular Weight261.12
Purity98.00%
Density1.43
Boiling Point374.1ºC at 760 mmHg
Melting Point135-140 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50670-58-1 |
| Catalog No. | 2A-9043297 |
| Chinese Name | 4'-溴-[1,1'-二苯基]-4-甲醛 |
| Synonyms | 4'-bromo-[1,1'-biphenyl]-4-carboxaldehyde; AMTDA048; 4'-Bromo-4-formylbiphenyl; 4'-bromo-4-biphenylcarboxaldehyde; 4'-BROMO-BIPHENYL-4-CARBALDEHYDE; 4-(4'-bromophenyl)benzaldehyde; 4'-Bromo-[1,1'-biphenyl]-4-carbaldehyde |
| Molecular Formula | C13H9BrO |
| Molecular Weight | 261.12 |
| Purity | 98.00 |
| Density | 1.43 |
| Boiling Point | 374.1ºC at 760 mmHg |
| Melting Point | 135-140 °C |
| Storage Condition | room temperature |
| HTC | 2913000090 |
| PubChem ID | 7569284 |
| SMILES | O=Cc1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C13H9BrO/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-9H |
| InChI Key | AZDGDDGUHUQQMO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Methoxybenzeneboronic acid | 45713-46-0 | 2A-9043126 |
| 4-(4-Chlorophenyl)cyclohexanecarboxylic acid | 49708-81-8 | 2A-9043204 |
| Chloromethyl chlorosulfate | 49715-04-0 | 2A-9043206 |
| Methyl 4'-methyl[1,1'-biphenyl]-4-carboxylate | 49742-56-5 | 2A-9043207 |
| 2-(Chloromethyl)-2-imidazoline | 50342-08-0 | 2A-9043235 |
| 3',4'-Dichlorobiphenyl-4-carbaldehyde | 50670-78-5 | 2A-9043298 |
| Tetrahydrothiopyran-4-carbaldehyde | 50675-19-9 | 2A-9043302 |
| 2-Diphenylphosphinobenzaldehyde | 50777-76-9 | 2A-9043320 |
| 2-Chloro-4-methylbenzaldehyde | 50817-80-6 | 2A-9043326 |
| 3-(Trifluoromethoxy)benzaldehyde | 50823-91-1 | 2A-9043331 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA