
CAS Number49773-20-8
Synonyms2-(Methylsulfonyl)ethanamine; 2-Aminoethyl methyl sulfone; AEMS; 2-methanesulfonyl-ethylamine; Ethanamine,2-(methylsulfonyl); 2-AMINOETHYLPHENYLSULFONE HYDROCHLORIDE; methanesulfonylethyl amine; 2-methanesulphonyl-ethylamine; 2-methanesulfonylethan-1-amine; 2-(methylsulphonyl)ethylamine; 1-(methylsulfonyl)eth-2-ylamine
Molecular FormulaC3H9NO2S
Molecular Weight123.18
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point307.9±25.0 °C at 760 mmHg
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 49773-20-8 |
| Catalog No. | 2A-9043212 |
| Chinese Name | 2-(甲磺酰基)乙胺 |
| Synonyms | 2-(Methylsulfonyl)ethanamine; 2-Aminoethyl methyl sulfone; AEMS; 2-methanesulfonyl-ethylamine; Ethanamine,2-(methylsulfonyl); 2-AMINOETHYLPHENYLSULFONE HYDROCHLORIDE; methanesulfonylethyl amine; 2-methanesulphonyl-ethylamine; 2-methanesulfonylethan-1-amine; 2-(methylsulphonyl)ethylamine; 1-(methylsulfonyl)eth-2-ylamine |
| Molecular Formula | C3H9NO2S |
| Molecular Weight | 123.18 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 307.9±25.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | 2-8°C, protected from light, inert gas |
| HTC | 2921199090 |
| PubChem ID | 6383374 |
| SMILES | CS(=O)(=O)CCN |
| InChI | InChI=1S/C3H9NO2S/c4-2-1-3-7(5)6/h1-4H2,(H,5,6)/p-1 |
| InChI Key | SDNXQWUJWNTDCC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Rimexolone | 49697-38-3 | 2A-9043201 |
| 4-Amino-2,5-dimethoxy-N-methylbenzenesulphonamide | 49701-24-8 | 2A-9043202 |
| Dobutamine hydrochloride | 49745-95-1 | 2A-9043208 |
| 4-Methyl-D-phenylalanine | 49759-61-7 | 2A-9043209 |
| 4-Cyanophenyl 4-pentylbenzoate | 49763-64-6 | 2A-9043210 |
| 2-Bromophenacyl bromide | 49851-55-0 | 2A-9043222 |
| Pergascript Red I 6B | 50292-95-0 | 2A-9043228 |
| Bromotris(dimethylamino)phosphonium hexafluorophosphate | 50296-37-2 | 2A-9043230 |
| 4-Vinylbenzylamine | 50325-49-0 | 2A-9043232 |
| 5-Bromoquinoxalin-6-amine | 50358-63-9 | 2A-9043237 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA