
CAS Number47355-10-2
SynonymsMFCD00065992; Boc-Trp(N-CHO)-OH; Boc-W(N-CHO)-OH; Boc-Trp(CHO)-OH; BOC-Trp(CHO); (S)-2-((tert-Butoxycarbonyl)amino)-3-(1-formyl-1H-indol-3-yl)propanoic acid
Molecular FormulaC17H20N2O5
Molecular Weight332.351
Purity98.00%
Density1.3±0.1 g/cm3
Melting Point100ºC
AppearanceWhite to off-white powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 47355-10-2 |
| Catalog No. | 2A-9043157 |
| Chinese Name | Nα-叔丁氧羰基-N'-醛基-L-色氨酸 |
| Synonyms | MFCD00065992; Boc-Trp(N-CHO)-OH; Boc-W(N-CHO)-OH; Boc-Trp(CHO)-OH; BOC-Trp(CHO); (S)-2-((tert-Butoxycarbonyl)amino)-3-(1-formyl-1H-indol-3-yl)propanoic acid |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.351 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Melting Point | 100ºC |
| Appearance | White to off-white powder |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933990090 |
| PubChem ID | 16537085 |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cn(C=O)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H20N2O5/c1-17(2,3)24-16(23)18-13(15(21)22)8-11-9-19(10-20)14-7-5-4-6-12(11)14/h4-7,9-10,13H,8H2,1-3H3,(H,18,23)(H,21,22)/t13-/m0/s1 |
| InChI Key | IHXHBYFWSOYYTR-ZDUSSCGKSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-(-)-Phenylsuccinic acid | 46292-93-7 | 2A-9043145 |
| Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid 2-ethoxyethyl ester | 46399-60-4 | 2A-9043147 |
| Ethyl (S)-2-amino-4-phenylbutyrate | 46460-23-5 | 2A-9043149 |
| (S)-(-)-1,1-Diphenyl-1,2-propanediol | 46755-94-6 | 2A-9043153 |
| N-Boc-O-Benzyl-D-serine | 47173-80-8 | 2A-9043155 |
| 4-Cyanobenzenesulfonyl chloride | 49584-26-1 | 2A-9043178 |
| L-Cyclobutylglycine, (S)-alpha-Amino-cyclobutaneacetic acid; | 49607-08-1 | 2A-9043182 |
| D-Cyclobutylglycine,(R)-2-Amino-2-cyclobutylacetic acid | 49607-10-5 | 2A-9043183 |
| (2S,5R)-trans-5-Hydroxypiperidine-2-carboxylic acid | 50439-45-7 | 2A-9043252 |
| (+)-3-Carboxy-2,2,5,5-tetramethylpyrrolidinyl-1-oxy | 50525-83-2 | 2A-9043261 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA