
CAS Number45115-53-5
Synonyms2,2,3,3,3-Pentafluoropropylmethacrylate; 2,2,3,3,3-PENTAFLUOROPROPYL DIFLUOROMETHYL ETHER; MFCD00039256; 2,2,3,3,3-PENTAFLUORO-N-PROPYL METHACRYLATE; 1H,1H-Pentafluoro-n-propyl Iodie; Methacrylic acid 2,2,3,3,3-pentafluoropropyl ester; EINECS 256-191-8; 2,2,3,3,3-pentafluoroproyl-2-Methacrylate; 2,2,3,3,3-Pentafluoropropyl 2-methylprop-2-enoate; 1H,1H-PENTAFLUORO-N-PROPYL METHACRYLATE
Molecular FormulaH2C=C(CH3)CO2CH2CF2CF3
Molecular Weight218.12
Purity97%
Density1.277 g/mL at 25 °C(lit.)
Boiling Point55 °C/100 mmHg (lit.)
AppearanceLiquid;Colorless to Almost colorless clear liquid
EINECS256-191-8
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 45115-53-5 |
| Catalog No. | 2A-9043108 |
| Chinese Name | 甲基丙烯酸2,2,3,3,3-五氟丙酯 |
| Synonyms | 2,2,3,3,3-Pentafluoropropylmethacrylate; 2,2,3,3,3-PENTAFLUOROPROPYL DIFLUOROMETHYL ETHER; MFCD00039256; 2,2,3,3,3-PENTAFLUORO-N-PROPYL METHACRYLATE; 1H,1H-Pentafluoro-n-propyl Iodie; Methacrylic acid 2,2,3,3,3-pentafluoropropyl ester; EINECS 256-191-8; 2,2,3,3,3-pentafluoroproyl-2-Methacrylate; 2,2,3,3,3-Pentafluoropropyl 2-methylprop-2-enoate; 1H,1H-PENTAFLUORO-N-PROPYL METHACRYLATE |
| Molecular Formula | H2C=C(CH3)CO2CH2CF2CF3 |
| Molecular Weight | 218.12 |
| Purity | 97 |
| Density | 1.277 g/mL at 25 °C(lit.) |
| Boiling Point | 55 °C/100 mmHg (lit.) |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Sealed, cool and dry storage |
| Packaging | III |
| EINECS | 256-191-8 |
| HTC | 2916140000 |
| PubChem ID | 24870968 |
| MDL Number | MFCD00039256 |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | 1S/C7H7F5O2/c1-4(2)5(13)14-3-6(8,9)7(10,11)12/h1,3H2,2H3 |
| InChI Key | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12352103 |
| Hazard Symbols | 3 |
| MSDS | msds/43108_1_45115_53_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 80.0% |
| Transport Info | Product name: Summary 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dithia-1,7-heptanediol | 44860-68-6 | 2A-9043101 |
| Acryloyloxyethyltrimethyl ammonium chloride | 44992-01-0 | 2A-9043104 |
| 4-Methylnonanoic acid | 45019-28-1 | 2A-9043105 |
| 2-[(Dimethylamino)methylene]-N1,N1,N3,N3-tetramethyl-1,3-propanediaminium | 45084-94-4 | 2A-9043106 |
| 2,2,3,3-Tetrafluoropropyl methacrylate | 45102-52-1 | 2A-9043107 |
| 1,16-Dibromohexadecane | 45223-18-5 | 2A-9043110 |
| 2-Thienylzinc bromide | 45438-80-0 | 2A-9043116 |
| 1-(Aminomethyl)cyclopentanol | 45511-81-7 | 2A-9043117 |
| [(1,1-Dioxidotetrahydro-3-thienyl)methyl]amine | 45697-13-0 | 2A-9043125 |
| 1-Aminomethylcycloheptanol | 45732-95-4 | 2A-9043127 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA