
CAS Number44742-89-4
Synonymsammonium fumarate; diammonium fumarate; diammonium salt of fumaric acid; Maleic acid 1-ammonium salt; Maleic acid monoammonium salt; fumaric acid ammonium salt
Molecular FormulaC4H7NO4
Molecular Weight133.10300
Purity98.00%
Density1.499g/cm3
Boiling Point400.7ºC at 760 mmHg
Melting Point138-139ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 44742-89-4 |
| Catalog No. | 2A-9043099 |
| Chinese Name | 顺丁烯二酸氢铵 |
| Synonyms | ammonium fumarate; diammonium fumarate; diammonium salt of fumaric acid; Maleic acid 1-ammonium salt; Maleic acid monoammonium salt; fumaric acid ammonium salt |
| Molecular Formula | C4H7NO4 |
| Molecular Weight | 133.10300 |
| Purity | 98.00 |
| Density | 1.499g/cm3 |
| Boiling Point | 400.7ºC at 760 mmHg |
| Melting Point | 138-139ºC |
| HTC | 2923900090 |
| PubChem ID | 16695920 |
| SMILES | O=C([O-])C=CC(=O)O.[NH4+] |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
| InChI Key | NLVWBYNKMPGKRG-ODZAUARKSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product Name: Summary 2923900090 other quaternary ammonium salts and hydroxides. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D(-)-4-Chlorophenylglycine | 43189-37-3 | 2A-9043086 |
| Zopiclone | 43200-80-2 | 2A-9043087 |
| Bis(2-bromoethyl)amine hydrobromide | 43204-63-3 | 2A-9043090 |
| 2-Amino-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide monohydrochloride | 43218-56-0 | 2A-9043093 |
| D-Threoninol | 44520-55-0 | 2A-9043098 |
| 3,5-Dithia-1,7-heptanediol | 44860-68-6 | 2A-9043101 |
| Acryloyloxyethyltrimethyl ammonium chloride | 44992-01-0 | 2A-9043104 |
| 4-Methylnonanoic acid | 45019-28-1 | 2A-9043105 |
| 2-[(Dimethylamino)methylene]-N1,N1,N3,N3-tetramethyl-1,3-propanediaminium | 45084-94-4 | 2A-9043106 |
| 2,2,3,3-Tetrafluoropropyl methacrylate | 45102-52-1 | 2A-9043107 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA