
CAS Number43141-69-1
SynonymsN,N-dibutyl-3-amino-phenol; 3-(di-n-butylamino)phenol; m-dibutylaminophenol; N,N-DIBUTYL-M-AMINOPHENOL; MFCD00134668; 3-(N,N-di-n-butylamino)phenol; N,N-DI-N-BUTYL-3-AMINOPHENOL; 3-(Dibutylamino)phenol; N,N-Dibutyl-3-aminophenol
Molecular FormulaC14H23O1N1
Molecular Weight221.34
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point348.7±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 43141-69-1 |
| Catalog No. | 2A-9043083 |
| Chinese Name | N,N-二丁基-3-氨基苯酚 |
| Synonyms | N,N-dibutyl-3-amino-phenol; 3-(di-n-butylamino)phenol; m-dibutylaminophenol; N,N-DIBUTYL-M-AMINOPHENOL; MFCD00134668; 3-(N,N-di-n-butylamino)phenol; N,N-DI-N-BUTYL-3-AMINOPHENOL; 3-(Dibutylamino)phenol; N,N-Dibutyl-3-aminophenol |
| Molecular Formula | C14H23O1N1 |
| Molecular Weight | 221.34 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 348.7±15.0 °C at 760 mmHg |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2922299090 |
| PubChem ID | 8693935 |
| MDL Number | MFCD00134668 |
| SMILES | CCCCN(CCCC)c1cccc(O)c1 |
| InChI | InChI=1S/C14H23NO/c1-3-5-10-15(11-6-4-2)13-8-7-9-14(16)12-13/h7-9,12,16H,3-6,10-11H2,1-2H3 |
| InChI Key | KHSTZMGCKHBFJX-UHFFFAOYSA-N |
| MSDS | msds/43083_1_43141_69_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2,6,6-Trimethyl-cyclohex-2-enyl)-but-2-en-1-one | 43052-87-5 | 2A-9043069 |
| Tetrabutylammonium cyanoborohydride | 43064-96-6 | 2A-9043071 |
| 2-Chloro-6-phenylnicotinonitrile | 43083-14-3 | 2A-9043075 |
| 1-(3-Methoxy-5-methylphenyl)ethanone | 43113-94-6 | 2A-9043078 |
| Benzimidazol-2-one | 43135-91-7 | 2A-9043081 |
| N-(2-Methoxyethyl)propylamine | 43175-57-1 | 2A-9043085 |
| D(-)-4-Chlorophenylglycine | 43189-37-3 | 2A-9043086 |
| Zopiclone | 43200-80-2 | 2A-9043087 |
| Bis(2-bromoethyl)amine hydrobromide | 43204-63-3 | 2A-9043090 |
| 2-Amino-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide monohydrochloride | 43218-56-0 | 2A-9043093 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA