
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 43039-98-1 |
| Catalog No. | 2A-9043065 |
| Chinese Name | 2-丙酰噻唑 |
| Synonyms | 1-(Thiazol-2-yl)propan-1-one; 1-(1,3-thiazol-2-yl)propan-1-one; MFCD01681404 |
| Molecular Formula | C6H7NOS |
| Molecular Weight | 141.19 |
| Purity | 98.00 |
| Density | 1.174 |
| Boiling Point | 110°C/5mm |
| Appearance | Liquid;Colorless to Light yellow to Light orange clear liquid |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2934100090 |
| PubChem ID | 8189609 |
| SMILES | CCC(=O)c1nccs1 |
| InChI | InChI=1S/C6H7NOS/c1-2-5(8)6-7-3-4-9-6/h3-4H,2H2,1H3 |
| InChI Key | TYRAENAWSLPSLW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Amino-2,3-dihydrobenzo[b]furan | 42933-43-7 | 2A-9043048 |
| 1-Butyl-2-methylindole | 42951-35-9 | 2A-9043052 |
| 6-Ethoxypyridine-2-carboxylic acid | 42955-22-6 | 2A-9043054 |
| 3-Amino-4-ethylpyrazole | 43024-15-3 | 2A-9043062 |
| Ethyl 7-hydroxypyrazolo[1,5-a]pyrimidine-6-carboxylate | 43024-61-9 | 2A-9043063 |
| 2-(Dimethylaminomethyl)pyridine | 43071-19-8 | 2A-9043072 |
| 4-Chloro-5-methylthieno[2,3-d]pyrimidine | 43088-67-1 | 2A-9043076 |
| 6-(5-Chloro-2-pyridyl)-6,7-dihydro-7-hydroxy-5H-pyrrolo[3,4-b]pyrazin-5-one | 43200-81-3 | 2A-9043088 |
| 6-(5-Chloro-2-pyridyl)-5H-pyrrolo[3,4-b]pyrazine-5,7(6H)-dione | 43200-82-4 | 2A-9043089 |
| 1,2,3,4-Tetrahydro-7-methoxyisoquinoline | 43207-78-9 | 2A-9043091 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA