
CAS Number42835-89-2
Synonyms2-methyl-6-fluoro-1,2,3,4-tetrahydroquinoline; 6-Fluoro-1,2,3,4-tetrahydro-2-methylquinoline; (±)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline; 6-fluorotetrahydroquinaldine; (RS)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline; EINECS 255-963-1
Molecular FormulaC10H12N1F1
Molecular Weight165.21
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point254.6±29.0 °C at 760 mmHg
Melting Point31-33ºC
AppearanceWhite to light yellow crystalline low melting point solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42835-89-2 |
| Catalog No. | 2A-9043018 |
| Chinese Name | 6-氟-1,2,3,4-四氢-2-甲基喹啉 |
| Synonyms | 2-methyl-6-fluoro-1,2,3,4-tetrahydroquinoline; 6-Fluoro-1,2,3,4-tetrahydro-2-methylquinoline; (±)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline; 6-fluorotetrahydroquinaldine; (RS)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline; EINECS 255-963-1 |
| Molecular Formula | C10H12N1F1 |
| Molecular Weight | 165.21 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 254.6±29.0 °C at 760 mmHg |
| Melting Point | 31-33ºC |
| Appearance | White to light yellow crystalline low melting point solid |
| Storage Condition | 2-8°C |
| HTC | 2933499090 |
| PubChem ID | 3140252 |
| MDL Number | MFCD00040976 |
| SMILES | CC1CCc2cc(F)ccc2N1 |
| InChI | InChI=1S/C10H12FN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h4-7,12H,2-3H2,1H3 |
| InChI Key | BDCCXYVTXRUGAN-UHFFFAOYSA-N |
| MSDS | msds/43018_1_42835_89_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-AMINO-4-BROMOPYRIMIDINE | 849353-34-0 | 2A-9042986 |
| 2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine | 42573-57-9 | 2A-9042994 |
| 2,5-Dichlorofuran | 42587-83-7 | 2A-9042998 |
| 5-Methyl-3-hydroxypyridine | 42732-49-0 | 2A-9043004 |
| 4,6-Dichloro-1H-pyrazolo[3,4-d]pyrimidine | 42754-96-1 | 2A-9043006 |
| 4-Pyrimidinecarbonitrile (7CI,9CI) | 42839-04-3 | 2A-9043020 |
| 2-Pyrimidinemethanol | 42839-09-8 | 2A-9043021 |
| N-Benzyl-2,6-piperidinedion | 42856-43-9 | 2A-9043023 |
| 2-Acetyl-3-bromothiophene | 42877-08-7 | 2A-9043034 |
| 4-Bromo-6-methoxyquinoline | 42881-66-3 | 2A-9043035 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA