
CAS Number157373-00-7
Synonyms3-chloro-2,4-difluoro-benzoyl chloride; 3-Chloro-2,4-difluorobenzoyl chloride; MFCD01631463; GVR CG BF DF
Molecular FormulaC7H2Cl2F2O
Molecular Weight210.993
Purity97%
Density1.5±0.1 g/cm3
Boiling Point206.9±35.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 157373-00-7 |
| Catalog No. | 2A-9004295 |
| Chinese Name | 3-氯-2,4-二氟苯甲酰氯 |
| Synonyms | 3-chloro-2,4-difluoro-benzoyl chloride; 3-Chloro-2,4-difluorobenzoyl chloride; MFCD01631463; GVR CG BF DF |
| Molecular Formula | C7H2Cl2F2O |
| Molecular Weight | 210.993 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 206.9±35.0 °C at 760 mmHg |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| Packaging | II |
| HTC | 2916399090 |
| SMILES | O=C(Cl)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C7H2Cl2F2O/c8-5-4(10)2-1-3(6(5)11)7(9)12/h1-2H |
| InChI Key | XGKKQSXUVHMKGM-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3-Bromo-2,4-dichlorotoluene | 206559-41-3 | 2A-9004160 |
| 3-Bromobenzylmercaptan | 886497-84-3 | 2A-9004263 |
| 3-Chloro-2,4,5-trifluorobenzoic acid | 101513-77-3 | 2A-9004292 |
| 3-Chloro-2,4-difluorobenzoic acid | 154257-75-7 | 2A-9004293 |
| 3-Chloro-2,4-difluorobenzonitrile | 887267-38-1 | 2A-9004294 |
| 3-Cyclopropyl-2-(2,4-dichloro-5-fluorobenzoyl)aminoacrylic acid methyl ester | 2A-104431 | 2A-9004431 |
| 3-Hydroxy-2,4,5-trifluorobenzoic acid | 116751-24-7 | 2A-9004528 |
| 3-Methoxy-2,4,5-trifluorobenzoic acid | 112811-65-1 | 2A-9004589 |
| 3-Methoxy-2,4,5-trifluorobenzonitrile | 2A-104590 | 2A-9004590 |
| 3-Methoxy-2,4-difluorobenzonitrile | 220353-20-8 | 2A-9004591 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA