
CAS Number41122-71-8
Synonyms4'-Heptylbiphenyl-4-carbonitrile; 4'-Heptyl-[1,1'-biphenyl]-4-carbonitrile; MFCD00074915; NCR DR D7; 4-heptyl-4'-cyanobiphenyl; 4-Cyano-4'-heptylbiphenyl; 4-(4-heptylphenyl)benzonitrile; 4'-Heptyl-4-biphenylcarbonitrile; 4'-n-Heptyl-4-biphenylcarbonitrile; p-Cyano-p'-heptylbiphenyl; EINECS 255-229-0; 4-Heptyl-4'-cyanobiphenyl
Molecular FormulaCH3(CH2)6C6H4C6H4CN
Molecular Weight277.40
Purity98%
Density1.0±0.1 g/cm3
Boiling Point420.9±34.0 °C at 760 mmHg
Melting Point30-32°C
Appearanceliquid crystal
EINECS255-229-0
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41122-71-8 |
| Catalog No. | 2A-9042730 |
| Chinese Name | 4-庚基-4'-氰基联苯 |
| Synonyms | 4'-Heptylbiphenyl-4-carbonitrile; 4'-Heptyl-[1,1'-biphenyl]-4-carbonitrile; MFCD00074915; NCR DR D7; 4-heptyl-4'-cyanobiphenyl; 4-Cyano-4'-heptylbiphenyl; 4-(4-heptylphenyl)benzonitrile; 4'-Heptyl-4-biphenylcarbonitrile; 4'-n-Heptyl-4-biphenylcarbonitrile; p-Cyano-p'-heptylbiphenyl; EINECS 255-229-0; 4-Heptyl-4'-cyanobiphenyl |
| Molecular Formula | CH3(CH2)6C6H4C6H4CN |
| Molecular Weight | 277.40 |
| Purity | 98 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 420.9±34.0 °C at 760 mmHg |
| Melting Point | 30-32°C |
| Appearance | liquid crystal |
| Storage Condition | Sealed, cool and dry storage |
| Packaging | III |
| EINECS | 255-229-0 |
| HTC | 2926909090 |
| PubChem ID | 24859917 |
| MDL Number | MFCD00074915 |
| SMILES | CCCCCCCc1ccc(cc1)-c2ccc(cc2)C#N |
| InChI | 1S/C20H23N/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)20-14-10-18(16-21)11-15-20/h8-15H,2-7H2,1H3 |
| InChI Key | ZGOWXOZNUNZPAV-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12352103 |
| Hazard Symbols | 6.1 |
| MSDS | msds/42730_1_41122_71_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,1'-Dioctadecyl-3,3,3',3'-tetramethylindocarbocyanine perchlorate | 41085-99-8 | 2A-9042719 |
| 1-Chloro-9,10-bis(phenylethynyl)anthracene | 41105-35-5 | 2A-9042726 |
| 2-Chloro-9,10-bis(phenylethynyl)anthracene | 41105-36-6 | 2A-9042727 |
| 2,5-Anhydro-D-mannitol | 41107-82-8 | 2A-9042728 |
| Nysted Reagent | 41114-59-4 | 2A-9042729 |
| N,N'-(2-Chloro-5-methyl-1,4-phenylene)bis(3-oxobutyramide) | 41131-65-1 | 2A-9042731 |
| N-(2,5-Dioxooxolan-3-yl)acetamide | 41148-79-2 | 2A-9042735 |
| Dimethyl (2-oxo-4-phenylbutyl)phosphonate | 41162-19-0 | 2A-9042737 |
| 8-Hydroxyjulolidine | 41175-50-2 | 2A-9042739 |
| Apramycin sulfate | 41194-16-5 | 2A-9042742 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA