
CAS Number40843-25-2
Synonyms(RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionic acid; Diclofop; Caswell No. 328B; Diclofop acid; rac-(2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid; DICHLORFOP ACID; 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid
Molecular FormulaC15H12Cl2O4
Molecular Weight327.16
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point440.5±45.0 °C at 760 mmHg
Melting Point39-40ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40843-25-2 |
| Catalog No. | 2A-9042660 |
| Chinese Name | 禾草灵 |
| Synonyms | (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionic acid; Diclofop; Caswell No. 328B; Diclofop acid; rac-(2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid; DICHLORFOP ACID; 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid |
| Molecular Formula | C15H12Cl2O4 |
| Molecular Weight | 327.16 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 440.5±45.0 °C at 760 mmHg |
| Melting Point | 39-40ºC |
| Appearance | white powder |
| Storage Condition | -20°C |
| HTC | 2918990025 |
| PubChem ID | 329757808 |
| SMILES | CC(Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19) |
| InChI Key | OOLBCHYXZDXLDS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloro-5-nitrophenol | 39489-77-5 | 2A-9042330 |
| 2,4-Dichloro-3-methyl-6-nitrophenol | 39549-27-4 | 2A-9042353 |
| 2,4-Dichloropyrido[3,2-d]pyrimidine | 39551-54-7 | 2A-9042356 |
| 5-Bromoindole-3-acetic acid | 40432-84-6 | 2A-9042573 |
| Glyphosate-ammonium | 40465-66-5 | 2A-9042580 |
| 4-(2,4-Dichlorophenoxy)phenol | 40843-73-0 | 2A-9042662 |
| N-[4-Bromo-2-(2-pyridylcarbonyl)phenyl]-2-chloroacetamide | 41526-21-0 | 2A-9042804 |
| 2,4-Diamino-5-pyrimidinemethanol | 42310-45-2 | 2A-9042946 |
| 2,4-dioxo-1,3-diazetidine-1,3-bis(methyl-m-phenylene) diisocyanate | 26747-90-0 | 2A-9043016 |
| Triadimefon | 43121-43-3 | 2A-9043080 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA