
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40422-73-9 |
| Catalog No. | 2A-9042571 |
| Chinese Name | 4-(2-溴乙基)苯乙酮 |
| Synonyms | einecs 254-914-1 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 288.30 |
| Purity | 98.00 |
| Density | 1.36g/cm3 |
| Boiling Point | 300.2ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2914700090 |
| PubChem ID | 329815582 |
| MDL Number | MFCD00597841 |
| SMILES | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1OC |
| InChI | 1S/C16H16O5/c1-20-15-6-3-10(8-16(15)21-2)7-13(18)12-5-4-11(17)9-14(12)19/h3-6,8-9,17,19H,7H2,1-2H3 |
| InChI Key | LRXMMYWDVBYTPO-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/42571_1_40422_73_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Dichloronicotinonitrile | 40381-90-6 | 2A-9042561 |
| Disodium 4,4'-(2,9-dimethyl-1,10-phenanthroline-4,7-diyl)bis(benzenesulphonate) | 40386-51-4 | 2A-9042563 |
| 2,4,6-Trimethylbenzylamine | 40393-99-5 | 2A-9042565 |
| 2-Iodobenzyl bromide | 40400-13-3 | 2A-9042566 |
| 2-(2-Thienyl)ethyl 4-methylbenzenesulfonate | 40412-06-4 | 2A-9042570 |
| 4-Methyl-1-phenylpentan-3-one | 40463-09-0 | 2A-9042577 |
| 3-Pyrrolidinol | 40499-83-0 | 2A-9042588 |
| 4-(4-Methylphenyl)cyclohexanone | 40503-90-0 | 2A-9042589 |
| 2-Amino-4'-methoxyacetophenone | 40513-43-7 | 2A-9042591 |
| 2-Heptyl-4-quinolone | 40522-46-1 | 2A-9042593 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA