
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40172-05-2 |
| Catalog No. | 2A-9042517 |
| Chinese Name | N-(2,6-二氯苄基)乙醇胺 |
| Synonyms | 2-(2,6-Dichlor-benzylamino)-aethanol; N-(2,6-dichlorobenzyl)ethanolamine; 2-[(2,6-dichlorobenzyl)amino]ethanol |
| Molecular Formula | C19H17Cl2N |
| Molecular Weight | 330.26 |
| Purity | 98.00 |
| Density | 1.302 |
| Boiling Point | 347.2ºC at 760 mmHg |
| Melting Point | 57-59ºC |
| HTC | 2922199090 |
| PubChem ID | 6967912 |
| MDL Number | MFCD00033048 |
| SMILES | OCCNCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H11Cl2NO/c10-8-2-1-3-9(11)7(8)6-12-4-5-13/h1-3,12-13H,4-6H2 |
| InChI Key | WHOLKBDVEGPXOL-UHFFFAOYSA-N |
| MSDS | msds/42517_1_40172_05_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| Titanium bis(triethanolamine)diisopropoxide | 36673-16-2 | 2A-9041843 |
| Pyridazin-3-ylmethanol | 37444-46-5 | 2A-9041962 |
| (1-Methyl-1H-imidazol-5-yl)methanol | 38993-84-9 | 2A-9042242 |
| Diphenyl(4-vinylphenyl)phosphine-divinylbenzene-styrene copolymer | 39319-11-4 | 2A-9042314 |
| Divinylbenzene-styrenesulfonic acid copolymer | 39389-20-3 | 2A-9042317 |
| (4-Benzylmorpholin-2-yl)methanol | 40987-24-4 | 2A-9042699 |
| D-Alanine benzyl ester p-toluenesulfonate salt | 41036-32-2 | 2A-9042706 |
| 2-Bromo-3-nitrotoluene | 41085-43-2 | 2A-9042718 |
| 4-Iodo-2-nitrotoluene | 41252-97-5 | 2A-9042755 |
| 1-(2-Thienylthio)acetone | 41444-33-1 | 2A-9042789 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA