
CAS Number39115-96-3
SynonymsMFCD00007600; 3-Bromobenzhydrazide; 3-Bromobenzohydrazide; 3-Bromobenzoic hydrazide; EINECS 254-298-4; Benzoic acid, 3-bromo-, hydrazide
Molecular FormulaC7H7BrN2O
Molecular Weight215.047
Purity98%
Density1.6±0.1 g/cm3
Boiling Point368.5ºC at 760 mmHg
Melting Point155-156°C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39115-96-3 |
| Catalog No. | 2A-9004251 |
| Chinese Name | 3-溴苄肼 |
| Synonyms | MFCD00007600; 3-Bromobenzhydrazide; 3-Bromobenzohydrazide; 3-Bromobenzoic hydrazide; EINECS 254-298-4; Benzoic acid, 3-bromo-, hydrazide |
| Molecular Formula | C7H7BrN2O |
| Molecular Weight | 215.047 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 368.5ºC at 760 mmHg |
| Melting Point | 155-156°C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Sealed, cool, dry storage |
| HTC | 2928000090 |
| SMILES | NNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C7H7BrN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChI Key | BNAQRAZIPAHWAR-UHFFFAOYSA-N |
| MSDS | msds/4251_1_39115_96_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Bromo-4-chlorobenzhydrazide | 148993-18-4 | 2A-9004196 |
| 3-Bromo-4-fluorobenzaldehyde | 77771-02-9 | 2A-9004209 |
| 3-Bromo-4-fluorobenzamidoxime | 845866-56-0 | 2A-9004210 |
| 3-Bromo-5-(trifluoromethyl)benzene sulphonyl chloride | 351003-46-8 | 2A-9004238 |
| 3-Bromo-5-fluorobenzaldehyde | 188813-02-7 | 2A-9004244 |
| 3-Carboxybenzaldehyde | 619-21-6 | 2A-9004283 |
| 3-Carboxyphenylboronic acid | 25487-66-5 | 2A-9004284 |
| 3-Chloro-2,6-difluorobenzaldehyde | 190011-87-1 | 2A-9004298 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde | 261763-02-4 | 2A-9004302 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride | 261763-03-5 | 2A-9004303 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA