
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39755-95-8 |
| Catalog No. | 2A-9042404 |
| Chinese Name | 5-甲氧基靛红 |
| Synonyms | 5-Methoxy-1H-indole-2,3-dione; MFCD00169023; 5-Methoxyindole-2,3-dione; 5-Methoxy-2,3-indolinedione; EINECS 212-271-4 |
| Molecular Formula | C9H7O3N1 |
| Molecular Weight | 177.16 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Melting Point | 201-203°C |
| Appearance | brown solid |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933990090 |
| PubChem ID | 395703 |
| MDL Number | MFCD00169023 |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C9H7NO3/c1-13-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
| InChI Key | DMHGXMPXHPOXBF-UHFFFAOYSA-N |
| MSDS | msds/42404_1_39755_95_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Ethyl-p-menthane-3-carboxamide | 39711-79-0 | 2A-9042392 |
| 4-Pentenoyl chloride | 39716-58-0 | 2A-9042393 |
| N-Benzoyl-L-aspartic acid 4-methyl ester | 39741-26-9 | 2A-9042395 |
| 2-Chloro-6-methylpyridin-3-amine | 39745-40-9 | 2A-9042401 |
| (-)-Corey lactone benzoate | 39746-00-4 | 2A-9042402 |
| DL-3-Amino-3-(4-bromophenyl)propionic acid | 39773-47-2 | 2A-9042407 |
| 2-Benzylaminoacetamide | 39796-49-1 | 2A-9042413 |
| Propionamidine hydrochloride | 39800-84-5 | 2A-9042414 |
| 1-Acetyl-5-methyl-2-thioxo-4-imidazolidinone | 39806-38-7 | 2A-9042416 |
| Methyl 3-oxoheptanoate | 39815-78-6 | 2A-9042419 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA