CAS Number39562-17-9
SynonymsMethyl 2-(3-nitrobenzylidene)-3-oxobutanoate; Methyl 2-(3-nitrobenzylidene)-3-oxobutyrate; 3-Nitrobenzylidenacetessigsaeuremethylester; ETHYL 3-NITROBENZYLIDENACETOACETATE; EINECS 405-270-7; WNR C1UYV1&VO1; Butanoic acid, 2-[(3-nitrophenyl)methylene]-3-oxo-, methyl ester; MFCD00142134
Molecular FormulaC12H11NO5
Molecular Weight249.219
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point387.5±32.0 °C at 760 mmHg
Melting Point158ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39562-17-9 |
| Catalog No. | 2A-9042359 |
| Chinese Name | 3-硝基苯叉基乙酰乙酸乙酯 |
| Synonyms | Methyl 2-(3-nitrobenzylidene)-3-oxobutanoate; Methyl 2-(3-nitrobenzylidene)-3-oxobutyrate; 3-Nitrobenzylidenacetessigsaeuremethylester; ETHYL 3-NITROBENZYLIDENACETOACETATE; EINECS 405-270-7; WNR C1UYV1&VO1; Butanoic acid, 2-[(3-nitrophenyl)methylene]-3-oxo-, methyl ester; MFCD00142134 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.219 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 387.5±32.0 °C at 760 mmHg |
| Melting Point | 158ºC |
| Storage Condition | 2-8℃, dry, sealed |
| HTC | 2918300090 |
| PubChem ID | 7454352 |
| SMILES | COC(=O)C(=Cc1cccc([N+](=O)[O-])c1)C(C)=O |
| InChI | InChI=1S/C12H11NO5/c1-8(14)11(12(15)18-2)7-9-4-3-5-10(6-9)13(16)17/h3-7H,1-2H3 |
| InChI Key | LYUBYLJQOZIBQB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-tert-Butylbenzoylacetonitrile | 39528-62-6 | 2A-9042349 |
| Isonipecotamide | 39546-32-2 | 2A-9042352 |
| 2-Amino-4,6-dichloro-5-methylphenol hydrochloride | 39549-31-0 | 2A-9042354 |
| 2-Amino-4-methylbenzamide | 39549-79-6 | 2A-9042355 |
| 4-Vinylbenzo-18-crown-6 | 39557-71-6 | 2A-9042358 |
| Isopropyl 2-(3-nitrobenzylidene)acetoacetate | 39562-25-9 | 2A-9042361 |
| 1-Eth-1-ynyl-4-propoxybenzene | 39604-97-2 | 2A-9042368 |
| 3-Chloro-4-nitrobenzoic acid | 39608-47-4 | 2A-9042369 |
| 4,4'-Sulphonylbis(2,6-dibromophenol) | 39635-79-5 | 2A-9042373 |
| 1,4-Dibromoadamantane | 39646-72-5 | 2A-9042376 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS