
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39178-60-4 |
| Catalog No. | 2A-9042279 |
| Chinese Name | 5-溴-2-乙基苯并呋喃 |
| Synonyms | Benzofuran,5-bromo-2-ethyl; 5-bromo-2-ethylbenzo[b]furan; 5-bromo-2-ethylbenzofuran |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 307.10 |
| Purity | 98.00 |
| Density | 1.448 |
| Boiling Point | 269ºC |
| Melting Point | 24-25ºC |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2932999099 |
| PubChem ID | 329749004 |
| SMILES | CCc1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C10H9BrO/c1-2-9-6-7-5-8(11)3-4-10(7)12-9/h3-6H,2H2,1H3 |
| InChI Key | IXCGZKOZXSKKFI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Methylimidazole-5-carboxaldehyde | 39021-62-0 | 2A-9042248 |
| 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid | 39091-01-5 | 2A-9042260 |
| Thiomorpholine-1,1-dioxide | 39093-93-1 | 2A-9042261 |
| 4-Amino-1-benzyl-4-piperidinecarboxylic acid | 39143-25-4 | 2A-9042268 |
| 5-Chloro-2-ethylbenzofuran | 39178-59-1 | 2A-9042278 |
| 2-Chloro-3,4-diaminopyridine | 39217-08-8 | 2A-9042290 |
| 2-Amino-5-tert-butyl-1,3,4-thiadiazole | 39222-73-6 | 2A-9042292 |
| 2-(2-Bromoethyl)pyridine | 39232-04-7 | 2A-9042294 |
| 5-Methylisoxazole-3-carbonyl chloride | 39499-34-8 | 2A-9042332 |
| Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate | 39514-19-7 | 2A-9042341 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA